diff --git a/legged_gym/legged_gym/utils/terrain/__init__.py b/legged_gym/legged_gym/utils/terrain/__init__.py index f4179fc..d012688 100644 --- a/legged_gym/legged_gym/utils/terrain/__init__.py +++ b/legged_gym/legged_gym/utils/terrain/__init__.py @@ -4,6 +4,7 @@ terrain_registry = dict( Terrain= "legged_gym.utils.terrain.terrain:Terrain", BarrierTrack= "legged_gym.utils.terrain.barrier_track:BarrierTrack", TerrainPerlin= "legged_gym.utils.terrain.perlin:TerrainPerlin", + TerrainExtreme="legged_gym.utils.terrain.terrain_extreme:Terrain" ) def get_terrain_cls(terrain_cls): diff --git a/legged_gym/legged_gym/utils/terrain/terrain_extreme.py b/legged_gym/legged_gym/utils/terrain/terrain_extreme.py new file mode 100644 index 0000000..58418a6 --- /dev/null +++ b/legged_gym/legged_gym/utils/terrain/terrain_extreme.py @@ -0,0 +1,915 @@ +# SPDX-FileCopyrightText: Copyright (c) 2021 NVIDIA CORPORATION & AFFILIATES. All rights reserved. +# SPDX-License-Identifier: BSD-3-Clause +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are met: +# +# 1. Redistributions of source code must retain the above copyright notice, this +# list of conditions and the following disclaimer. +# +# 2. Redistributions in binary form must reproduce the above copyright notice, +# this list of conditions and the following disclaimer in the documentation +# and/or other materials provided with the distribution. +# +# 3. Neither the name of the copyright holder nor the names of its +# contributors may be used to endorse or promote products derived from +# this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +# DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE +# FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +# DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR +# SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER +# CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, +# OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +# +# Copyright (c) 2021 ETH Zurich, Nikita Rudin + +import numpy as np +from numpy.random import choice +from scipy import interpolate +import random +from isaacgym import terrain_utils +from legged_gym.envs.base.legged_robot_config import LeggedRobotCfg +from scipy import ndimage +from pydelatin import Delatin +import pyfqmr +from scipy.ndimage import binary_dilation + + +class Terrain: + def __init__(self, cfg: LeggedRobotCfg.terrain, num_robots) -> None: + self.cfg = cfg + self.num_robots = num_robots + self.type = cfg.mesh_type + if self.type in ["none", 'plane']: + return + self.env_length = cfg.terrain_length + self.env_width = cfg.terrain_width + + cfg.terrain_proportions = np.array(cfg.terrain_proportions) / np.sum(cfg.terrain_proportions) + self.proportions = [np.sum(cfg.terrain_proportions[:i+1]) for i in range(len(cfg.terrain_proportions))] + self.cfg.num_sub_terrains = cfg.num_rows * cfg.num_cols + self.env_origins = np.zeros((cfg.num_rows, cfg.num_cols, 3)) + self.terrain_type = np.zeros((cfg.num_rows, cfg.num_cols)) + # self.env_slope_vec = np.zeros((cfg.num_rows, cfg.num_cols, 3)) + self.goals = np.zeros((cfg.num_rows, cfg.num_cols, cfg.num_goals, 3)) + self.num_goals = cfg.num_goals + + self.width_per_env_pixels = int(self.env_width / cfg.horizontal_scale) + self.length_per_env_pixels = int(self.env_length / cfg.horizontal_scale) + + self.border = int(cfg.border_size/self.cfg.horizontal_scale) + self.tot_cols = int(cfg.num_cols * self.width_per_env_pixels) + 2 * self.border + self.tot_rows = int(cfg.num_rows * self.length_per_env_pixels) + 2 * self.border + + self.height_field_raw = np.zeros((self.tot_rows , self.tot_cols), dtype=np.int16) + if cfg.curriculum: + self.curriculum() + elif cfg.selected: + self.selected_terrain() + else: + if hasattr(cfg, "max_difficulty"): + self.curriculum(random=True, max_difficulty=cfg.max_difficulty) + else: + self.curriculum(random=True) + # self.randomized_terrain() + + self.heightsamples = self.height_field_raw + if self.type=="trimesh": + print("Converting heightmap to trimesh...") + if cfg.hf2mesh_method == "grid": + self.vertices, self.triangles, self.x_edge_mask = convert_heightfield_to_trimesh( self.height_field_raw, + self.cfg.horizontal_scale, + self.cfg.vertical_scale, + self.cfg.slope_treshold) + half_edge_width = int(self.cfg.edge_width_thresh / self.cfg.horizontal_scale) + structure = np.ones((half_edge_width*2+1, 1)) + self.x_edge_mask = binary_dilation(self.x_edge_mask, structure=structure) + if self.cfg.simplify_grid: + mesh_simplifier = pyfqmr.Simplify() + mesh_simplifier.setMesh(self.vertices, self.triangles) + mesh_simplifier.simplify_mesh(target_count = int(0.05*self.triangles.shape[0]), aggressiveness=7, preserve_border=True, verbose=10) + + self.vertices, self.triangles, normals = mesh_simplifier.getMesh() + self.vertices = self.vertices.astype(np.float32) + self.triangles = self.triangles.astype(np.uint32) + else: + assert cfg.hf2mesh_method == "fast", "Height field to mesh method must be grid or fast" + self.vertices, self.triangles = convert_heightfield_to_trimesh_delatin(self.height_field_raw, self.cfg.horizontal_scale, self.cfg.vertical_scale) + print("Created {} vertices".format(self.vertices.shape[0])) + print("Created {} triangles".format(self.triangles.shape[0])) + + def randomized_terrain(self): + for k in range(self.cfg.num_sub_terrains): + # Env coordinates in the world + (i, j) = np.unravel_index(k, (self.cfg.num_rows, self.cfg.num_cols)) + + choice = np.random.uniform(0, 1) + # difficulty = np.random.choice([0.5, 0.75, 0.9]) + difficulty = np.random.uniform(-0.2, 1.2) + terrain = self.make_terrain(choice, difficulty) + self.add_terrain_to_map(terrain, i, j) + + def curriculum(self, random=False, max_difficulty=False): + for j in range(self.cfg.num_cols): + for i in range(self.cfg.num_rows): + difficulty = i / (self.cfg.num_rows-1) + choice = j / self.cfg.num_cols + 0.001 + if random: + if max_difficulty: + terrain = self.make_terrain(choice, np.random.uniform(0.7, 1)) + else: + terrain = self.make_terrain(choice, np.random.uniform(0, 1)) + else: + terrain = self.make_terrain(choice, difficulty) + + self.add_terrain_to_map(terrain, i, j) + + def selected_terrain(self): + terrain_type = self.cfg.terrain_kwargs.pop('type') + for k in range(self.cfg.num_sub_terrains): + # Env coordinates in the world + (i, j) = np.unravel_index(k, (self.cfg.num_rows, self.cfg.num_cols)) + + terrain = terrain_utils.SubTerrain("terrain", + width=self.width_per_env_pixels, + length=self.length_per_env_pixels, + vertical_scale=self.vertical_scale, + horizontal_scale=self.horizontal_scale) + + eval(terrain_type)(terrain, **self.cfg.terrain_kwargs.terrain_kwargs) + self.add_terrain_to_map(terrain, i, j) + + def add_roughness(self, terrain, difficulty=1): + max_height = (self.cfg.height[1] - self.cfg.height[0]) * difficulty + self.cfg.height[0] + height = random.uniform(self.cfg.height[0], max_height) + terrain_utils.random_uniform_terrain(terrain, min_height=-height, max_height=height, step=0.005, downsampled_scale=self.cfg.downsampled_scale) + + def make_terrain(self, choice, difficulty): + terrain = terrain_utils.SubTerrain( "terrain", + width=self.length_per_env_pixels, + length=self.width_per_env_pixels, + vertical_scale=self.cfg.vertical_scale, + horizontal_scale=self.cfg.horizontal_scale) + slope = difficulty * 0.4 + step_height = 0.02 + 0.14 * difficulty + discrete_obstacles_height = 0.03 + difficulty * 0.15 + stepping_stones_size = 1.5 * (1.05 - difficulty) + stone_distance = 0.05 if difficulty==0 else 0.1 + gap_size = 1. * difficulty + pit_depth = 1. * difficulty + if choice < self.proportions[0]: + idx = 0 + if choice < self.proportions[0]/ 2: + idx = 1 + slope *= -1 + terrain_utils.pyramid_sloped_terrain(terrain, slope=slope, platform_size=3.) + # self.add_roughness(terrain) + elif choice < self.proportions[2]: + idx = 2 + if choice 1: + half_slope_difficulty = 1.0 + elif difficulty < 0: + self.add_roughness(terrain) + terrain.slope_vector = np.array([1, 0., 0]).astype(np.float32) + return terrain + else: + half_slope_difficulty = difficulty + wall_width = 4 - half_slope_difficulty * 4 + # terrain_utils.wall_terrain(terrain, height=1, start2center=0.7) + # terrain_utils.tanh_terrain(terrain, height=1.0, start2center=0.7) + if self.cfg.flat_wall: + half_sloped_terrain(terrain, wall_width=4, start2center=0.5, max_height=0.00) + else: + half_sloped_terrain(terrain, wall_width=wall_width, start2center=0.5, max_height=1.5) + max_height = terrain.height_field_raw.max() + top_mask = terrain.height_field_raw > max_height - 0.05 + self.add_roughness(terrain, difficulty=1) + terrain.height_field_raw[top_mask] = max_height + elif choice < self.proportions[11]: + idx = 12 + # half platform terrain + half_platform_terrain(terrain, max_height=0.1 + 0.4 * difficulty ) + self.add_roughness(terrain, difficulty=1) + elif choice < self.proportions[13]: + idx = 13 + height = 0.1 + 0.3 * difficulty + if choice < self.proportions[12]: + idx = 14 + height *= -1 + terrain_utils.pyramid_stairs_terrain(terrain, step_width=1., step_height=height, platform_size=3.) + self.add_roughness(terrain) + elif choice < self.proportions[14]: + x_range = [-0.1, 0.1+0.3*difficulty] # offset to stone_len + y_range = [0.2, 0.3+0.1*difficulty] + stone_len = [0.9 - 0.3*difficulty, 1 - 0.2*difficulty]#2 * round((0.6) / 2.0, 1) + incline_height = 0.25*difficulty + last_incline_height = incline_height + 0.1 - 0.1*difficulty + parkour_terrain(terrain, + num_stones=self.num_goals - 2, + x_range=x_range, + y_range=y_range, + incline_height=incline_height, + stone_len=stone_len, + stone_width=1.0, + last_incline_height=last_incline_height, + pad_height=0, + pit_depth=[0.2, 1]) + idx = 15 + # terrain.height_field_raw[:] = 0 + self.add_roughness(terrain) + elif choice < self.proportions[15]: + idx = 16 + parkour_hurdle_terrain(terrain, + num_stones=self.num_goals - 2, + stone_len=0.1+0.3*difficulty, + hurdle_height_range=[0.1+0.1*difficulty, 0.15+0.25*difficulty], + pad_height=0, + x_range=[1.2, 2.2], + y_range=self.cfg.y_range, + half_valid_width=[0.4, 0.8], + ) + # terrain.height_field_raw[:] = 0 + self.add_roughness(terrain) + elif choice < self.proportions[16]: + idx = 17 + parkour_hurdle_terrain(terrain, + num_stones=self.num_goals - 2, + stone_len=0.1+0.3*difficulty, + hurdle_height_range=[0.1+0.1*difficulty, 0.15+0.15*difficulty], + pad_height=0, + y_range=self.cfg.y_range, + half_valid_width=[0.45, 1], + flat=True + ) + self.add_roughness(terrain) + elif choice < self.proportions[17]: + idx = 18 + parkour_step_terrain(terrain, + num_stones=self.num_goals - 2, + step_height=0.1 + 0.35*difficulty, + x_range=[0.3,1.5], + y_range=self.cfg.y_range, + half_valid_width=[0.5, 1], + pad_height=0, + ) + self.add_roughness(terrain) + elif choice < self.proportions[18]: + idx = 19 + parkour_gap_terrain(terrain, + num_gaps=self.num_goals - 2, + gap_size=0.1 + 0.7 * difficulty, + gap_depth=[0.2, 1], + pad_height=0, + x_range=[0.8, 1.5], + y_range=self.cfg.y_range, + half_valid_width=[0.6, 1.2], + # flat=True + ) + self.add_roughness(terrain) + elif choice < self.proportions[19]: + idx = 20 + demo_terrain(terrain) + self.add_roughness(terrain) + # np.set_printoptions(precision=2) + # print(np.array(self.proportions), choice) + terrain.idx = idx + return terrain + + def add_terrain_to_map(self, terrain, row, col): + i = row + j = col + # map coordinate system + start_x = self.border + i * self.length_per_env_pixels + end_x = self.border + (i + 1) * self.length_per_env_pixels + start_y = self.border + j * self.width_per_env_pixels + end_y = self.border + (j + 1) * self.width_per_env_pixels + self.height_field_raw[start_x: end_x, start_y:end_y] = terrain.height_field_raw + + # env_origin_x = (i + 0.5) * self.env_length + env_origin_x = i * self.env_length + 1.0 + env_origin_y = (j + 0.5) * self.env_width + x1 = int((self.env_length/2. - 0.5) / terrain.horizontal_scale) # within 1 meter square range + x2 = int((self.env_length/2. + 0.5) / terrain.horizontal_scale) + y1 = int((self.env_width/2. - 0.5) / terrain.horizontal_scale) + y2 = int((self.env_width/2. + 0.5) / terrain.horizontal_scale) + if self.cfg.origin_zero_z: + env_origin_z = 0 + else: + env_origin_z = np.max(terrain.height_field_raw[x1:x2, y1:y2])*terrain.vertical_scale + self.env_origins[i, j] = [env_origin_x, env_origin_y, env_origin_z] + self.terrain_type[i, j] = terrain.idx + self.goals[i, j, :, :2] = terrain.goals + [i * self.env_length, j * self.env_width] + # self.env_slope_vec[i, j] = terrain.slope_vector + +def gap_terrain(terrain, gap_size, platform_size=1.): + gap_size = int(gap_size / terrain.horizontal_scale) + platform_size = int(platform_size / terrain.horizontal_scale) + + center_x = terrain.length // 2 + center_y = terrain.width // 2 + x1 = (terrain.length - platform_size) // 2 + x2 = x1 + gap_size + y1 = (terrain.width - platform_size) // 2 + y2 = y1 + gap_size + + terrain.height_field_raw[center_x-x2 : center_x + x2, center_y-y2 : center_y + y2] = -1000 + terrain.height_field_raw[center_x-x1 : center_x + x1, center_y-y1 : center_y + y1] = 0 + +def gap_parkour_terrain(terrain, difficulty, platform_size=2.): + gap_size = 0.1 + 0.3 * difficulty + gap_size = int(gap_size / terrain.horizontal_scale) + platform_size = int(platform_size / terrain.horizontal_scale) + + center_x = terrain.length // 2 + center_y = terrain.width // 2 + x1 = (terrain.length - platform_size) // 2 + x2 = x1 + gap_size + y1 = (terrain.width - platform_size) // 2 + y2 = y1 + gap_size + + terrain.height_field_raw[center_x-x2 : center_x + x2, center_y-y2 : center_y + y2] = -400 + terrain.height_field_raw[center_x-x1 : center_x + x1, center_y-y1 : center_y + y1] = 0 + + slope_angle = 0.1 + difficulty * 1 + offset = 1 + 9 * difficulty#10 + scale = 15 + wall_center_x = [center_x - x1, center_x, center_x + x1] + wall_center_y = [center_y - y1, center_y, center_y + y1] + +def parkour_terrain(terrain, + platform_len=2.5, + platform_height=0., + num_stones=8, + x_range=[1.8, 1.9], + y_range=[0., 0.1], + z_range=[-0.2, 0.2], + stone_len=1.0, + stone_width=0.6, + pad_width=0.1, + pad_height=0.5, + incline_height=0.1, + last_incline_height=0.6, + last_stone_len=1.6, + pit_depth=[0.5, 1.]): + # 1st dimension: x, 2nd dimension: y + goals = np.zeros((num_stones+2, 2)) + terrain.height_field_raw[:] = -round(np.random.uniform(pit_depth[0], pit_depth[1]) / terrain.vertical_scale) + + mid_y = terrain.length // 2 # length is actually y width + stone_len = np.random.uniform(*stone_len) + stone_len = 2 * round(stone_len / 2.0, 1) + stone_len = round(stone_len / terrain.horizontal_scale) + dis_x_min = stone_len + round(x_range[0] / terrain.horizontal_scale) + dis_x_max = stone_len + round(x_range[1] / terrain.horizontal_scale) + dis_y_min = round(y_range[0] / terrain.horizontal_scale) + dis_y_max = round(y_range[1] / terrain.horizontal_scale) + dis_z_min = round(z_range[0] / terrain.vertical_scale) + dis_z_max = round(z_range[1] / terrain.vertical_scale) + + platform_len = round(platform_len / terrain.horizontal_scale) + platform_height = round(platform_height / terrain.vertical_scale) + terrain.height_field_raw[0:platform_len, :] = platform_height + + stone_width = round(stone_width / terrain.horizontal_scale) + last_stone_len = round(last_stone_len / terrain.horizontal_scale) + + incline_height = round(incline_height / terrain.vertical_scale) + last_incline_height = round(last_incline_height / terrain.vertical_scale) + + dis_x = platform_len - np.random.randint(dis_x_min, dis_x_max) + stone_len // 2 + goals[0] = [platform_len - stone_len // 2, mid_y] + left_right_flag = np.random.randint(0, 2) + # dis_z = np.random.randint(dis_z_min, dis_z_max) + dis_z = 0 + + for i in range(num_stones): + dis_x += np.random.randint(dis_x_min, dis_x_max) + pos_neg = round(2*(left_right_flag - 0.5)) + dis_y = mid_y + pos_neg * np.random.randint(dis_y_min, dis_y_max) + if i == num_stones - 1: + dis_x += last_stone_len // 4 + heights = np.tile(np.linspace(-last_incline_height, last_incline_height, stone_width), (last_stone_len, 1)) * pos_neg + terrain.height_field_raw[dis_x-last_stone_len//2:dis_x+last_stone_len//2, dis_y-stone_width//2: dis_y+stone_width//2] = heights.astype(int) + dis_z + else: + heights = np.tile(np.linspace(-incline_height, incline_height, stone_width), (stone_len, 1)) * pos_neg + terrain.height_field_raw[dis_x-stone_len//2:dis_x+stone_len//2, dis_y-stone_width//2: dis_y+stone_width//2] = heights.astype(int) + dis_z + + goals[i+1] = [dis_x, dis_y] + + left_right_flag = 1 - left_right_flag + final_dis_x = dis_x + 2*np.random.randint(dis_x_min, dis_x_max) + final_platform_start = dis_x + last_stone_len // 2 + round(0.05 // terrain.horizontal_scale) + terrain.height_field_raw[final_platform_start:, :] = platform_height + goals[-1] = [final_dis_x, mid_y] + + terrain.goals = goals * terrain.horizontal_scale + + # pad edges + pad_width = int(pad_width // terrain.horizontal_scale) + pad_height = int(pad_height // terrain.vertical_scale) + terrain.height_field_raw[:, :pad_width] = pad_height + terrain.height_field_raw[:, -pad_width:] = pad_height + terrain.height_field_raw[:pad_width, :] = pad_height + terrain.height_field_raw[-pad_width:, :] = pad_height + +def parkour_gap_terrain(terrain, + platform_len=2.5, + platform_height=0., + num_gaps=8, + gap_size=0.3, + x_range=[1.6, 2.4], + y_range=[-1.2, 1.2], + half_valid_width=[0.6, 1.2], + gap_depth=-200, + pad_width=0.1, + pad_height=0.5, + flat=False): + goals = np.zeros((num_gaps+2, 2)) + # terrain.height_field_raw[:] = -200 + # import ipdb; ipdb.set_trace() + mid_y = terrain.length // 2 # length is actually y width + + # dis_x_min = round(x_range[0] / terrain.horizontal_scale) + # dis_x_max = round(x_range[1] / terrain.horizontal_scale) + dis_y_min = round(y_range[0] / terrain.horizontal_scale) + dis_y_max = round(y_range[1] / terrain.horizontal_scale) + + platform_len = round(platform_len / terrain.horizontal_scale) + platform_height = round(platform_height / terrain.vertical_scale) + gap_depth = -round(np.random.uniform(gap_depth[0], gap_depth[1]) / terrain.vertical_scale) + + # half_gap_width = round(np.random.uniform(0.6, 1.2) / terrain.horizontal_scale) + half_valid_width = round(np.random.uniform(half_valid_width[0], half_valid_width[1]) / terrain.horizontal_scale) + # terrain.height_field_raw[:, :mid_y-half_valid_width] = gap_depth + # terrain.height_field_raw[:, mid_y+half_valid_width:] = gap_depth + + terrain.height_field_raw[0:platform_len, :] = platform_height + + gap_size = round(gap_size / terrain.horizontal_scale) + dis_x_min = round(x_range[0] / terrain.horizontal_scale) + gap_size + dis_x_max = round(x_range[1] / terrain.horizontal_scale) + gap_size + + dis_x = platform_len + goals[0] = [platform_len - 1, mid_y] + last_dis_x = dis_x + for i in range(num_gaps): + rand_x = np.random.randint(dis_x_min, dis_x_max) + dis_x += rand_x + rand_y = np.random.randint(dis_y_min, dis_y_max) + if not flat: + # terrain.height_field_raw[dis_x-stone_len//2:dis_x+stone_len//2, ] = np.random.randint(hurdle_height_min, hurdle_height_max) + # terrain.height_field_raw[dis_x-gap_size//2 : dis_x+gap_size//2, + # gap_center-half_gap_width:gap_center+half_gap_width] = gap_depth + terrain.height_field_raw[dis_x-gap_size//2 : dis_x+gap_size//2, :] = gap_depth + + terrain.height_field_raw[last_dis_x:dis_x, :mid_y+rand_y-half_valid_width] = gap_depth + terrain.height_field_raw[last_dis_x:dis_x, mid_y+rand_y+half_valid_width:] = gap_depth + + last_dis_x = dis_x + goals[i+1] = [dis_x-rand_x//2, mid_y + rand_y] + final_dis_x = dis_x + np.random.randint(dis_x_min, dis_x_max) + # import ipdb; ipdb.set_trace() + if final_dis_x > terrain.width: + final_dis_x = terrain.width - 0.5 // terrain.horizontal_scale + goals[-1] = [final_dis_x, mid_y] + + terrain.goals = goals * terrain.horizontal_scale + + # terrain.height_field_raw[:, :] = 0 + # pad edges + pad_width = int(pad_width // terrain.horizontal_scale) + pad_height = int(pad_height // terrain.vertical_scale) + terrain.height_field_raw[:, :pad_width] = pad_height + terrain.height_field_raw[:, -pad_width:] = pad_height + terrain.height_field_raw[:pad_width, :] = pad_height + terrain.height_field_raw[-pad_width:, :] = pad_height + +def parkour_hurdle_terrain(terrain, + platform_len=2.5, + platform_height=0., + num_stones=8, + stone_len=0.3, + x_range=[1.5, 2.4], + y_range=[-0.4, 0.4], + half_valid_width=[0.4, 0.8], + hurdle_height_range=[0.2, 0.3], + pad_width=0.1, + pad_height=0.5, + flat=False): + goals = np.zeros((num_stones+2, 2)) + # terrain.height_field_raw[:] = -200 + + mid_y = terrain.length // 2 # length is actually y width + + dis_x_min = round(x_range[0] / terrain.horizontal_scale) + dis_x_max = round(x_range[1] / terrain.horizontal_scale) + dis_y_min = round(y_range[0] / terrain.horizontal_scale) + dis_y_max = round(y_range[1] / terrain.horizontal_scale) + + # half_valid_width = round(np.random.uniform(y_range[1]+0.2, y_range[1]+1) / terrain.horizontal_scale) + half_valid_width = round(np.random.uniform(half_valid_width[0], half_valid_width[1]) / terrain.horizontal_scale) + hurdle_height_max = round(hurdle_height_range[1] / terrain.vertical_scale) + hurdle_height_min = round(hurdle_height_range[0] / terrain.vertical_scale) + + platform_len = round(platform_len / terrain.horizontal_scale) + platform_height = round(platform_height / terrain.vertical_scale) + terrain.height_field_raw[0:platform_len, :] = platform_height + + stone_len = round(stone_len / terrain.horizontal_scale) + # stone_width = round(stone_width / terrain.horizontal_scale) + + # incline_height = round(incline_height / terrain.vertical_scale) + # last_incline_height = round(last_incline_height / terrain.vertical_scale) + + dis_x = platform_len + goals[0] = [platform_len - 1, mid_y] + last_dis_x = dis_x + for i in range(num_stones): + rand_x = np.random.randint(dis_x_min, dis_x_max) + rand_y = np.random.randint(dis_y_min, dis_y_max) + dis_x += rand_x + if not flat: + terrain.height_field_raw[dis_x-stone_len//2:dis_x+stone_len//2, ] = np.random.randint(hurdle_height_min, hurdle_height_max) + terrain.height_field_raw[dis_x-stone_len//2:dis_x+stone_len//2, :mid_y+rand_y-half_valid_width] = 0 + terrain.height_field_raw[dis_x-stone_len//2:dis_x+stone_len//2, mid_y+rand_y+half_valid_width:] = 0 + last_dis_x = dis_x + goals[i+1] = [dis_x-rand_x//2, mid_y + rand_y] + final_dis_x = dis_x + np.random.randint(dis_x_min, dis_x_max) + # import ipdb; ipdb.set_trace() + if final_dis_x > terrain.width: + final_dis_x = terrain.width - 0.5 // terrain.horizontal_scale + goals[-1] = [final_dis_x, mid_y] + + terrain.goals = goals * terrain.horizontal_scale + + # terrain.height_field_raw[:, :max(mid_y-half_valid_width, 0)] = 0 + # terrain.height_field_raw[:, min(mid_y+half_valid_width, terrain.height_field_raw.shape[1]):] = 0 + # terrain.height_field_raw[:, :] = 0 + # pad edges + pad_width = int(pad_width // terrain.horizontal_scale) + pad_height = int(pad_height // terrain.vertical_scale) + terrain.height_field_raw[:, :pad_width] = pad_height + terrain.height_field_raw[:, -pad_width:] = pad_height + terrain.height_field_raw[:pad_width, :] = pad_height + terrain.height_field_raw[-pad_width:, :] = pad_height + +def parkour_step_terrain(terrain, + platform_len=2.5, + platform_height=0., + num_stones=8, + # x_range=[1.5, 2.4], + x_range=[0.2, 0.4], + y_range=[-0.15, 0.15], + half_valid_width=[0.45, 0.5], + step_height = 0.2, + pad_width=0.1, + pad_height=0.5): + goals = np.zeros((num_stones+2, 2)) + # terrain.height_field_raw[:] = -200 + mid_y = terrain.length // 2 # length is actually y width + + dis_x_min = round( (x_range[0] + step_height) / terrain.horizontal_scale) + dis_x_max = round( (x_range[1] + step_height) / terrain.horizontal_scale) + dis_y_min = round(y_range[0] / terrain.horizontal_scale) + dis_y_max = round(y_range[1] / terrain.horizontal_scale) + + step_height = round(step_height / terrain.vertical_scale) + + half_valid_width = round(np.random.uniform(half_valid_width[0], half_valid_width[1]) / terrain.horizontal_scale) + + platform_len = round(platform_len / terrain.horizontal_scale) + platform_height = round(platform_height / terrain.vertical_scale) + terrain.height_field_raw[0:platform_len, :] = platform_height + + # stone_width = round(stone_width / terrain.horizontal_scale) + + # incline_height = round(incline_height / terrain.vertical_scale) + # last_incline_height = round(last_incline_height / terrain.vertical_scale) + + dis_x = platform_len + last_dis_x = dis_x + stair_height = 0 + goals[0] = [platform_len - round(1 / terrain.horizontal_scale), mid_y] + for i in range(num_stones): + rand_x = np.random.randint(dis_x_min, dis_x_max) + rand_y = np.random.randint(dis_y_min, dis_y_max) + if i < num_stones // 2: + stair_height += step_height + elif i > num_stones // 2: + stair_height -= step_height + terrain.height_field_raw[dis_x:dis_x+rand_x, ] = stair_height + dis_x += rand_x + terrain.height_field_raw[last_dis_x:dis_x, :mid_y+rand_y-half_valid_width] = 0 + terrain.height_field_raw[last_dis_x:dis_x, mid_y+rand_y+half_valid_width:] = 0 + + last_dis_x = dis_x + goals[i+1] = [dis_x-rand_x//2, mid_y+rand_y] + final_dis_x = dis_x + np.random.randint(dis_x_min, dis_x_max) + # import ipdb; ipdb.set_trace() + if final_dis_x > terrain.width: + final_dis_x = terrain.width - 0.5 // terrain.horizontal_scale + goals[-1] = [final_dis_x, mid_y] + + terrain.goals = goals * terrain.horizontal_scale + + # terrain.height_field_raw[:, :max(mid_y-half_valid_width, 0)] = 0 + # terrain.height_field_raw[:, min(mid_y+half_valid_width, terrain.height_field_raw.shape[1]):] = 0 + # terrain.height_field_raw[:, :] = 0 + # pad edges + pad_width = int(pad_width // terrain.horizontal_scale) + pad_height = int(pad_height // terrain.vertical_scale) + terrain.height_field_raw[:, :pad_width] = pad_height + terrain.height_field_raw[:, -pad_width:] = pad_height + terrain.height_field_raw[:pad_width, :] = pad_height + terrain.height_field_raw[-pad_width:, :] = pad_height + +def demo_terrain(terrain): + goals = np.zeros((8, 2)) + mid_y = terrain.length // 2 + + # hurdle + platform_length = round(2 / terrain.horizontal_scale) + hurdle_depth = round(np.random.uniform(0.35, 0.4) / terrain.horizontal_scale) + hurdle_height = round(np.random.uniform(0.3, 0.36) / terrain.vertical_scale) + hurdle_width = round(np.random.uniform(1, 1.2) / terrain.horizontal_scale) + goals[0] = [platform_length + hurdle_depth/2, mid_y] + terrain.height_field_raw[platform_length:platform_length+hurdle_depth, round(mid_y-hurdle_width/2):round(mid_y+hurdle_width/2)] = hurdle_height + + # step up + platform_length += round(np.random.uniform(1.5, 2.5) / terrain.horizontal_scale) + first_step_depth = round(np.random.uniform(0.45, 0.8) / terrain.horizontal_scale) + first_step_height = round(np.random.uniform(0.35, 0.45) / terrain.vertical_scale) + first_step_width = round(np.random.uniform(1, 1.2) / terrain.horizontal_scale) + goals[1] = [platform_length+first_step_depth/2, mid_y] + terrain.height_field_raw[platform_length:platform_length+first_step_depth, round(mid_y-first_step_width/2):round(mid_y+first_step_width/2)] = first_step_height + + platform_length += first_step_depth + second_step_depth = round(np.random.uniform(0.45, 0.8) / terrain.horizontal_scale) + second_step_height = first_step_height + second_step_width = first_step_width + goals[2] = [platform_length+second_step_depth/2, mid_y] + terrain.height_field_raw[platform_length:platform_length+second_step_depth, round(mid_y-second_step_width/2):round(mid_y+second_step_width/2)] = second_step_height + + # gap + platform_length += second_step_depth + gap_size = round(np.random.uniform(0.5, 0.8) / terrain.horizontal_scale) + + # step down + platform_length += gap_size + third_step_depth = round(np.random.uniform(0.25, 0.6) / terrain.horizontal_scale) + third_step_height = first_step_height + third_step_width = round(np.random.uniform(1, 1.2) / terrain.horizontal_scale) + goals[3] = [platform_length+third_step_depth/2, mid_y] + terrain.height_field_raw[platform_length:platform_length+third_step_depth, round(mid_y-third_step_width/2):round(mid_y+third_step_width/2)] = third_step_height + + platform_length += third_step_depth + forth_step_depth = round(np.random.uniform(0.25, 0.6) / terrain.horizontal_scale) + forth_step_height = first_step_height + forth_step_width = third_step_width + goals[4] = [platform_length+forth_step_depth/2, mid_y] + terrain.height_field_raw[platform_length:platform_length+forth_step_depth, round(mid_y-forth_step_width/2):round(mid_y+forth_step_width/2)] = forth_step_height + + # parkour + platform_length += forth_step_depth + gap_size = round(np.random.uniform(0.1, 0.4) / terrain.horizontal_scale) + platform_length += gap_size + + left_y = mid_y + round(np.random.uniform(0.15, 0.3) / terrain.horizontal_scale) + right_y = mid_y - round(np.random.uniform(0.15, 0.3) / terrain.horizontal_scale) + + slope_height = round(np.random.uniform(0.15, 0.22) / terrain.vertical_scale) + slope_depth = round(np.random.uniform(0.75, 0.85) / terrain.horizontal_scale) + slope_width = round(1.0 / terrain.horizontal_scale) + + platform_height = slope_height + np.random.randint(0, 0.2 / terrain.vertical_scale) + + goals[5] = [platform_length+slope_depth/2, left_y] + heights = np.tile(np.linspace(-slope_height, slope_height, slope_width), (slope_depth, 1)) * 1 + terrain.height_field_raw[platform_length:platform_length+slope_depth, left_y-slope_width//2: left_y+slope_width//2] = heights.astype(int) + platform_height + + platform_length += slope_depth + gap_size + goals[6] = [platform_length+slope_depth/2, right_y] + heights = np.tile(np.linspace(-slope_height, slope_height, slope_width), (slope_depth, 1)) * -1 + terrain.height_field_raw[platform_length:platform_length+slope_depth, right_y-slope_width//2: right_y+slope_width//2] = heights.astype(int) + platform_height + + platform_length += slope_depth + gap_size + round(0.4 / terrain.horizontal_scale) + goals[-1] = [platform_length, left_y] + terrain.goals = goals * terrain.horizontal_scale + +def pit_terrain(terrain, depth, platform_size=1.): + depth = int(depth / terrain.vertical_scale) + platform_size = int(platform_size / terrain.horizontal_scale / 2) + x1 = terrain.length // 2 - platform_size + x2 = terrain.length // 2 + platform_size + y1 = terrain.width // 2 - platform_size + y2 = terrain.width // 2 + platform_size + terrain.height_field_raw[x1:x2, y1:y2] = -depth + +def half_sloped_terrain(terrain, wall_width=4, start2center=0.7, max_height=1): + wall_width_int = max(int(wall_width / terrain.horizontal_scale), 1) + max_height_int = int(max_height / terrain.vertical_scale) + slope_start = int(start2center / terrain.horizontal_scale + terrain.length // 2) + terrain_length = terrain.length + height2width_ratio = max_height_int / wall_width_int + xs = np.arange(slope_start, terrain_length) + heights = (height2width_ratio * (xs - slope_start)).clip(max=max_height_int).astype(np.int16) + terrain.height_field_raw[slope_start:terrain_length, :] = heights[:, None] + terrain.slope_vector = np.array([wall_width_int*terrain.horizontal_scale, 0., max_height]).astype(np.float32) + terrain.slope_vector /= np.linalg.norm(terrain.slope_vector) + # print(terrain.slope_vector, wall_width) + # import matplotlib.pyplot as plt + # plt.imsave('test.png', terrain.height_field_raw, cmap='gray') + +def half_platform_terrain(terrain, start2center=2, max_height=1): + max_height_int = int(max_height / terrain.vertical_scale) + slope_start = int(start2center / terrain.horizontal_scale + terrain.length // 2) + terrain_length = terrain.length + terrain.height_field_raw[:, :] = max_height_int + terrain.height_field_raw[-slope_start:slope_start, -slope_start:slope_start] = 0 + # print(terrain.slope_vector, wall_width) + # import matplotlib.pyplot as plt + # plt.imsave('test.png', terrain.height_field_raw, cmap='gray') + +def stepping_stones_terrain(terrain, stone_size, stone_distance, max_height, platform_size=1., depth=-1): + """ + Generate a stepping stones terrain + + Parameters: + terrain (terrain): the terrain + stone_size (float): horizontal size of the stepping stones [meters] + stone_distance (float): distance between stones (i.e size of the holes) [meters] + max_height (float): maximum height of the stones (positive and negative) [meters] + platform_size (float): size of the flat platform at the center of the terrain [meters] + depth (float): depth of the holes (default=-10.) [meters] + Returns: + terrain (SubTerrain): update terrain + """ + def get_rand_dis_int(scale): + return np.random.randint(int(- scale / terrain.horizontal_scale + 1), int(scale / terrain.horizontal_scale)) + # switch parameters to discrete units + stone_size = int(stone_size / terrain.horizontal_scale) + stone_distance = int(stone_distance / terrain.horizontal_scale) + max_height = int(max_height / terrain.vertical_scale) + platform_size = int(platform_size / terrain.horizontal_scale) + height_range = np.arange(-max_height-1, max_height, step=1) + + start_x = 0 + start_y = 0 + terrain.height_field_raw[:, :] = int(depth / terrain.vertical_scale) + if terrain.length >= terrain.width: + while start_y < terrain.length: + stop_y = min(terrain.length, start_y + stone_size) + start_x = np.random.randint(0, stone_size) + # fill first hole + stop_x = max(0, start_x - stone_distance - get_rand_dis_int(0.2)) + terrain.height_field_raw[0: stop_x, start_y: stop_y] = np.random.choice(height_range) + # fill row + while start_x < terrain.width: + stop_x = min(terrain.width, start_x + stone_size) + terrain.height_field_raw[start_x: stop_x, start_y: stop_y] = np.random.choice(height_range) + start_x += stone_size + stone_distance + get_rand_dis_int(0.2) + start_y += stone_size + stone_distance + get_rand_dis_int(0.2) + elif terrain.width > terrain.length: + while start_x < terrain.width: + stop_x = min(terrain.width, start_x + stone_size) + start_y = np.random.randint(0, stone_size) + # fill first hole + stop_y = max(0, start_y - stone_distance) + terrain.height_field_raw[start_x: stop_x, 0: stop_y] = np.random.choice(height_range) + # fill column + while start_y < terrain.length: + stop_y = min(terrain.length, start_y + stone_size) + terrain.height_field_raw[start_x: stop_x, start_y: stop_y] = np.random.choice(height_range) + start_y += stone_size + stone_distance + start_x += stone_size + stone_distance + + x1 = (terrain.width - platform_size) // 2 + x2 = (terrain.width + platform_size) // 2 + y1 = (terrain.length - platform_size) // 2 + y2 = (terrain.length + platform_size) // 2 + terrain.height_field_raw[x1:x2, y1:y2] = 0 + return terrain + +def convert_heightfield_to_trimesh_delatin(height_field_raw, horizontal_scale, vertical_scale, max_error=0.01): + mesh = Delatin(np.flip(height_field_raw, axis=1).T, z_scale=vertical_scale, max_error=max_error) + vertices = np.zeros_like(mesh.vertices) + vertices[:, :2] = mesh.vertices[:, :2] * horizontal_scale + vertices[:, 2] = mesh.vertices[:, 2] + return vertices, mesh.triangles + +def convert_heightfield_to_trimesh(height_field_raw, horizontal_scale, vertical_scale, slope_threshold=None): + """ + Convert a heightfield array to a triangle mesh represented by vertices and triangles. + Optionally, corrects vertical surfaces above the provide slope threshold: + + If (y2-y1)/(x2-x1) > slope_threshold -> Move A to A' (set x1 = x2). Do this for all directions. + B(x2,y2) + /| + / | + / | + (x1,y1)A---A'(x2',y1) + + Parameters: + height_field_raw (np.array): input heightfield + horizontal_scale (float): horizontal scale of the heightfield [meters] + vertical_scale (float): vertical scale of the heightfield [meters] + slope_threshold (float): the slope threshold above which surfaces are made vertical. If None no correction is applied (default: None) + Returns: + vertices (np.array(float)): array of shape (num_vertices, 3). Each row represents the location of each vertex [meters] + triangles (np.array(int)): array of shape (num_triangles, 3). Each row represents the indices of the 3 vertices connected by this triangle. + """ + hf = height_field_raw + num_rows = hf.shape[0] + num_cols = hf.shape[1] + + y = np.linspace(0, (num_cols-1)*horizontal_scale, num_cols) + x = np.linspace(0, (num_rows-1)*horizontal_scale, num_rows) + yy, xx = np.meshgrid(y, x) + + if slope_threshold is not None: + + slope_threshold *= horizontal_scale / vertical_scale + move_x = np.zeros((num_rows, num_cols)) + move_y = np.zeros((num_rows, num_cols)) + move_corners = np.zeros((num_rows, num_cols)) + move_x[:num_rows-1, :] += (hf[1:num_rows, :] - hf[:num_rows-1, :] > slope_threshold) + move_x[1:num_rows, :] -= (hf[:num_rows-1, :] - hf[1:num_rows, :] > slope_threshold) + move_y[:, :num_cols-1] += (hf[:, 1:num_cols] - hf[:, :num_cols-1] > slope_threshold) + move_y[:, 1:num_cols] -= (hf[:, :num_cols-1] - hf[:, 1:num_cols] > slope_threshold) + move_corners[:num_rows-1, :num_cols-1] += (hf[1:num_rows, 1:num_cols] - hf[:num_rows-1, :num_cols-1] > slope_threshold) + move_corners[1:num_rows, 1:num_cols] -= (hf[:num_rows-1, :num_cols-1] - hf[1:num_rows, 1:num_cols] > slope_threshold) + xx += (move_x + move_corners*(move_x == 0)) * horizontal_scale + yy += (move_y + move_corners*(move_y == 0)) * horizontal_scale + + # create triangle mesh vertices and triangles from the heightfield grid + vertices = np.zeros((num_rows*num_cols, 3), dtype=np.float32) + vertices[:, 0] = xx.flatten() + vertices[:, 1] = yy.flatten() + vertices[:, 2] = hf.flatten() * vertical_scale + triangles = -np.ones((2*(num_rows-1)*(num_cols-1), 3), dtype=np.uint32) + for i in range(num_rows - 1): + ind0 = np.arange(0, num_cols-1) + i*num_cols + ind1 = ind0 + 1 + ind2 = ind0 + num_cols + ind3 = ind2 + 1 + start = 2*i*(num_cols-1) + stop = start + 2*(num_cols-1) + triangles[start:stop:2, 0] = ind0 + triangles[start:stop:2, 1] = ind3 + triangles[start:stop:2, 2] = ind1 + triangles[start+1:stop:2, 0] = ind0 + triangles[start+1:stop:2, 1] = ind2 + triangles[start+1:stop:2, 2] = ind3 + + return vertices, triangles, move_x != 0 \ No newline at end of file