Merge branch 'main' into SimDynamixel

lerobot/__init__.py

@@ -129,6 +129,53 @@ available_real_world_datasets = [
     "lerobot/unitreeh1_rearrange_objects",
     "lerobot/unitreeh1_two_robot_greeting",
     "lerobot/unitreeh1_warehouse",
+    "lerobot/nyu_rot_dataset",
+    "lerobot/utokyo_saytap",
+    "lerobot/imperialcollege_sawyer_wrist_cam",
+    "lerobot/utokyo_xarm_bimanual",
+    "lerobot/tokyo_u_lsmo",
+    "lerobot/utokyo_pr2_opening_fridge",
+    "lerobot/cmu_franka_exploration_dataset",
+    "lerobot/cmu_stretch",
+    "lerobot/asu_table_top",
+    "lerobot/utokyo_pr2_tabletop_manipulation",
+    "lerobot/utokyo_xarm_pick_and_place",
+    "lerobot/ucsd_kitchen_dataset",
+    "lerobot/austin_buds_dataset",
+    "lerobot/dlr_sara_grid_clamp",
+    "lerobot/conq_hose_manipulation",
+    "lerobot/columbia_cairlab_pusht_real",
+    "lerobot/dlr_sara_pour",
+    "lerobot/dlr_edan_shared_control",
+    "lerobot/ucsd_pick_and_place_dataset",
+    "lerobot/berkeley_cable_routing",
+    "lerobot/nyu_franka_play_dataset",
+    "lerobot/austin_sirius_dataset",
+    "lerobot/cmu_play_fusion",
+    "lerobot/berkeley_gnm_sac_son",
+    "lerobot/nyu_door_opening_surprising_effectiveness",
+    "lerobot/berkeley_fanuc_manipulation",
+    "lerobot/jaco_play",
+    "lerobot/viola",
+    "lerobot/kaist_nonprehensile",
+    "lerobot/berkeley_mvp",
+    "lerobot/uiuc_d3field",
+    "lerobot/berkeley_gnm_recon",
+    "lerobot/austin_sailor_dataset",
+    "lerobot/utaustin_mutex",
+    "lerobot/roboturk",
+    "lerobot/stanford_hydra_dataset",
+    "lerobot/berkeley_autolab_ur5",
+    "lerobot/stanford_robocook",
+    "lerobot/toto",
+    "lerobot/fmb",
+    "lerobot/droid_100",
+    "lerobot/berkeley_rpt",
+    "lerobot/stanford_kuka_multimodal_dataset",
+    "lerobot/iamlab_cmu_pickup_insert",
+    "lerobot/taco_play",
+    "lerobot/berkeley_gnm_cory_hall",
+    "lerobot/usc_cloth_sim",
 ]
 
 available_datasets = list(

lerobot/common/datasets/compute_stats.py

@@ -40,6 +40,10 @@ def get_stats_einops_patterns(dataset, num_workers=0):
 
     stats_patterns = {}
     for key, feats_type in dataset.features.items():
+        # NOTE: skip language_instruction embedding in stats computation
+        if key == "language_instruction":
+            continue
+
         # sanity check that tensors are not float64
         assert batch[key].dtype != torch.float64
 

lerobot/common/datasets/push_dataset_to_hub/_download_raw.py

@@ -60,8 +60,8 @@ AVAILABLE_RAW_REPO_IDS = {
     "lerobot-raw/aloha_static_vinh_cup_left_raw": "aloha_hdf5",
     "lerobot-raw/aloha_static_vinh_cup_raw": "aloha_hdf5",
     "lerobot-raw/aloha_static_ziploc_slide_raw": "aloha_hdf5",
-    "lerobot-raw/pusht_raw": "pusht_zarr",
     "lerobot-raw/umi_cup_in_the_wild_raw": "umi_zarr",
+    "lerobot-raw/pusht_raw": "pusht_zarr",
     "lerobot-raw/unitreeh1_fold_clothes_raw": "aloha_hdf5",
     "lerobot-raw/unitreeh1_rearrange_objects_raw": "aloha_hdf5",
     "lerobot-raw/unitreeh1_two_robot_greeting_raw": "aloha_hdf5",
@@ -70,6 +70,74 @@ AVAILABLE_RAW_REPO_IDS = {
     "lerobot-raw/xarm_lift_medium_replay_raw": "xarm_pkl",
     "lerobot-raw/xarm_push_medium_raw": "xarm_pkl",
     "lerobot-raw/xarm_push_medium_replay_raw": "xarm_pkl",
+    "lerobot-raw/fractal20220817_data_raw": "openx_rlds.fractal20220817_data",
+    "lerobot-raw/kuka_raw": "openx_rlds.kuka",
+    "lerobot-raw/bridge_openx_raw": "openx_rlds.bridge_openx",
+    "lerobot-raw/taco_play_raw": "openx_rlds.taco_play",
+    "lerobot-raw/jaco_play_raw": "openx_rlds.jaco_play",
+    "lerobot-raw/berkeley_cable_routing_raw": "openx_rlds.berkeley_cable_routing",
+    "lerobot-raw/roboturk_raw": "openx_rlds.roboturk",
+    "lerobot-raw/nyu_door_opening_surprising_effectiveness_raw": "openx_rlds.nyu_door_opening_surprising_effectiveness",
+    "lerobot-raw/viola_raw": "openx_rlds.viola",
+    "lerobot-raw/berkeley_autolab_ur5_raw": "openx_rlds.berkeley_autolab_ur5",
+    "lerobot-raw/toto_raw": "openx_rlds.toto",
+    "lerobot-raw/language_table_raw": "openx_rlds.language_table",
+    "lerobot-raw/columbia_cairlab_pusht_real_raw": "openx_rlds.columbia_cairlab_pusht_real",
+    "lerobot-raw/stanford_kuka_multimodal_dataset_raw": "openx_rlds.stanford_kuka_multimodal_dataset",
+    "lerobot-raw/nyu_rot_dataset_raw": "openx_rlds.nyu_rot_dataset",
+    "lerobot-raw/io_ai_tech_raw": "openx_rlds.io_ai_tech",
+    "lerobot-raw/stanford_hydra_dataset_raw": "openx_rlds.stanford_hydra_dataset",
+    "lerobot-raw/austin_buds_dataset_raw": "openx_rlds.austin_buds_dataset",
+    "lerobot-raw/nyu_franka_play_dataset_raw": "openx_rlds.nyu_franka_play_dataset",
+    "lerobot-raw/maniskill_dataset_raw": "openx_rlds.maniskill_dataset",
+    "lerobot-raw/furniture_bench_dataset_raw": "openx_rlds.furniture_bench_dataset",
+    "lerobot-raw/cmu_franka_exploration_dataset_raw": "openx_rlds.cmu_franka_exploration_dataset",
+    "lerobot-raw/ucsd_kitchen_dataset_raw": "openx_rlds.ucsd_kitchen_dataset",
+    "lerobot-raw/ucsd_pick_and_place_dataset_raw": "openx_rlds.ucsd_pick_and_place_dataset",
+    "lerobot-raw/spoc_raw": "openx_rlds.spoc",
+    "lerobot-raw/austin_sailor_dataset_raw": "openx_rlds.austin_sailor_dataset",
+    "lerobot-raw/austin_sirius_dataset_raw": "openx_rlds.austin_sirius_dataset",
+    "lerobot-raw/bc_z_raw": "openx_rlds.bc_z",
+    "lerobot-raw/utokyo_pr2_opening_fridge_raw": "openx_rlds.utokyo_pr2_opening_fridge",
+    "lerobot-raw/utokyo_pr2_tabletop_manipulation_raw": "openx_rlds.utokyo_pr2_tabletop_manipulation",
+    "lerobot-raw/utokyo_xarm_pick_and_place_raw": "openx_rlds.utokyo_xarm_pick_and_place",
+    "lerobot-raw/utokyo_xarm_bimanual_raw": "openx_rlds.utokyo_xarm_bimanual",
+    "lerobot-raw/utokyo_saytap_raw": "openx_rlds.utokyo_saytap",
+    "lerobot-raw/robo_net_raw": "openx_rlds.robo_net",
+    "lerobot-raw/robo_set_raw": "openx_rlds.robo_set",
+    "lerobot-raw/berkeley_mvp_raw": "openx_rlds.berkeley_mvp",
+    "lerobot-raw/berkeley_rpt_raw": "openx_rlds.berkeley_rpt",
+    "lerobot-raw/kaist_nonprehensile_raw": "openx_rlds.kaist_nonprehensile",
+    "lerobot-raw/stanford_mask_vit_raw": "openx_rlds.stanford_mask_vit",
+    "lerobot-raw/tokyo_u_lsmo_raw": "openx_rlds.tokyo_u_lsmo",
+    "lerobot-raw/dlr_sara_pour_raw": "openx_rlds.dlr_sara_pour",
+    "lerobot-raw/dlr_sara_grid_clamp_raw": "openx_rlds.dlr_sara_grid_clamp",
+    "lerobot-raw/dlr_edan_shared_control_raw": "openx_rlds.dlr_edan_shared_control",
+    "lerobot-raw/asu_table_top_raw": "openx_rlds.asu_table_top",
+    "lerobot-raw/stanford_robocook_raw": "openx_rlds.stanford_robocook",
+    "lerobot-raw/imperialcollege_sawyer_wrist_cam_raw": "openx_rlds.imperialcollege_sawyer_wrist_cam",
+    "lerobot-raw/iamlab_cmu_pickup_insert_raw": "openx_rlds.iamlab_cmu_pickup_insert",
+    "lerobot-raw/uiuc_d3field_raw": "openx_rlds.uiuc_d3field",
+    "lerobot-raw/utaustin_mutex_raw": "openx_rlds.utaustin_mutex",
+    "lerobot-raw/berkeley_fanuc_manipulation_raw": "openx_rlds.berkeley_fanuc_manipulation",
+    "lerobot-raw/cmu_playing_with_food_raw": "openx_rlds.cmu_playing_with_food",
+    "lerobot-raw/cmu_play_fusion_raw": "openx_rlds.cmu_play_fusion",
+    "lerobot-raw/cmu_stretch_raw": "openx_rlds.cmu_stretch",
+    "lerobot-raw/berkeley_gnm_recon_raw": "openx_rlds.berkeley_gnm_recon",
+    "lerobot-raw/berkeley_gnm_cory_hall_raw": "openx_rlds.berkeley_gnm_cory_hall",
+    "lerobot-raw/berkeley_gnm_sac_son_raw": "openx_rlds.berkeley_gnm_sac_son",
+    "lerobot-raw/droid_raw": "openx_rlds.droid",
+    "lerobot-raw/droid_100_raw": "openx_rlds.droid100",
+    "lerobot-raw/fmb_raw": "openx_rlds.fmb",
+    "lerobot-raw/dobbe_raw": "openx_rlds.dobbe",
+    "lerobot-raw/usc_cloth_sim_raw": "openx_rlds.usc_cloth_sim",
+    "lerobot-raw/plex_robosuite_raw": "openx_rlds.plex_robosuite",
+    "lerobot-raw/conq_hose_manipulation_raw": "openx_rlds.conq_hose_manipulation",
+    "lerobot-raw/vima_raw": "openx_rlds.vima",
+    "lerobot-raw/robot_vqa_raw": "openx_rlds.robot_vqa",
+    "lerobot-raw/mimic_play_raw": "openx_rlds.mimic_play",
+    "lerobot-raw/tidybot_raw": "openx_rlds.tidybot",
+    "lerobot-raw/eth_agent_affordances_raw": "openx_rlds.eth_agent_affordances",
 }
 
 
@@ -110,7 +178,7 @@ def download_all_raw_datasets(data_dir: Path | None = None):
 def main():
     parser = argparse.ArgumentParser(
         description=f"""A script to download raw datasets from Hugging Face hub to a local directory. Here is a
-            non exhaustive list of available repositories to use in `--repo-id`: {AVAILABLE_RAW_REPO_IDS}""",
+            non exhaustive list of available repositories to use in `--repo-id`: {list(AVAILABLE_RAW_REPO_IDS.keys())}""",
     )
 
     parser.add_argument(

lerobot/common/datasets/push_dataset_to_hub/openx/configs.yaml

@@ -0,0 +1,640 @@
+OPENX_DATASET_CONFIGS:
+  fractal20220817_data:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - base_pose_tool_reached
+      - gripper_closed
+    fps: 3
+  
+  kuka:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - clip_function_input/base_pose_tool_reached
+      - gripper_closed
+    fps: 10
+  
+  bridge_openx:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - EEF_state
+      - gripper_state
+    fps: 5
+  
+  taco_play:
+    image_obs_keys:
+      - rgb_static
+      - rgb_gripper
+    depth_obs_keys:
+      - depth_static
+      - depth_gripper
+    state_obs_keys:
+      - state_eef
+      - state_gripper
+    fps: 15
+  
+  jaco_play:
+    image_obs_keys:
+      - image
+      - image_wrist
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state_eef
+      - state_gripper
+    fps: 10
+  
+  berkeley_cable_routing:
+    image_obs_keys:
+      - image
+      - top_image
+      - wrist45_image
+      - wrist225_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - robot_state
+    fps: 10
+
+  roboturk:
+    image_obs_keys:
+      - front_rgb
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - null
+    fps: 10
+  
+  nyu_door_opening_surprising_effectiveness:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - null
+    fps: 3
+
+  viola:
+    image_obs_keys:
+      - agentview_rgb
+      - eye_in_hand_rgb
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - joint_states
+      - gripper_states
+    fps: 20
+
+  berkeley_autolab_ur5:
+    image_obs_keys:
+      - image
+      - hand_image
+    depth_obs_keys:
+      - image_with_depth
+    state_obs_keys:
+      - state
+    fps: 5
+
+  toto:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 30
+
+  language_table:
+    image_obs_keys:
+      - rgb
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - effector_translation
+    fps: 10
+
+  columbia_cairlab_pusht_real:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - robot_state
+    fps: 10
+
+  stanford_kuka_multimodal_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - depth_image
+    state_obs_keys:
+      - ee_position
+      - ee_orientation
+    fps: 20
+
+  nyu_rot_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 3
+
+  io_ai_tech:
+    image_obs_keys:
+      - image
+      - image_fisheye
+      - image_left_side
+      - image_right_side
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 3
+
+  stanford_hydra_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 10
+
+  austin_buds_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 20
+
+  nyu_franka_play_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - image_additional_view
+    depth_obs_keys:
+      - depth
+      - depth_additional_view
+    state_obs_keys:
+      - eef_state
+    fps: 3
+
+  maniskill_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - depth
+      - wrist_depth
+    state_obs_keys:
+      - tcp_pose
+      - gripper_state
+    fps: 20
+
+  furniture_bench_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+
+  cmu_franka_exploration_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - highres_image
+    depth_obs_keys:
+      - null  
+    state_obs_keys:
+      - null
+    fps: 10
+
+  ucsd_kitchen_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - joint_state
+    fps: 2
+  
+  ucsd_pick_and_place_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 3
+  
+  spoc:
+    image_obs_keys:
+      - image
+      - image_manipulation
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - null
+    fps: 3
+  
+  austin_sailor_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 20
+  
+  austin_sirius_dataset_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 20
+  
+  bc_z:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - present/xyz
+      - present/axis_angle
+      - present/sensed_close
+    fps: 10
+  
+  utokyo_pr2_opening_fridge_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 10
+  
+  utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 10
+  
+  utokyo_xarm_pick_and_place_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - image2
+      - hand_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - end_effector_pose
+    fps: 10
+  
+  utokyo_xarm_bimanual_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - pose_r
+    fps: 10
+  
+  robo_net:
+    image_obs_keys:
+      - image
+      - image1
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 1
+  
+  robo_set:
+    image_obs_keys:
+      - image_left
+      - image_right
+      - image_wrist
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+      - state_velocity
+    fps: 5
+  
+  berkeley_mvp_converted_externally_to_rlds:
+    image_obs_keys:
+      - hand_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - gripper
+      - pose
+      - joint_pos
+    fps: 5
+  
+  berkeley_rpt_converted_externally_to_rlds:
+    image_obs_keys:
+      - hand_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - joint_pos
+      - gripper
+    fps: 30
+  
+  kaist_nonprehensile_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+  
+  stanford_mask_vit_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+  
+  tokyo_u_lsmo_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 10
+  
+  dlr_sara_pour_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+  
+  dlr_sara_grid_clamp_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state  
+    fps: 10
+  
+  dlr_edan_shared_control_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 5
+  
+  asu_table_top_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 12.5
+
+  stanford_robocook_converted_externally_to_rlds:
+    image_obs_keys:
+      - image_1
+      - image_2
+    depth_obs_keys:
+      - depth_1
+      - depth_2
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 5
+
+  imperialcollege_sawyer_wrist_cam:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+
+  iamlab_cmu_pickup_insert_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - joint_state
+      - gripper_state
+    fps: 20
+
+  uiuc_d3field:
+    image_obs_keys:
+      - image_1
+      - image_2
+    depth_obs_keys:
+      - depth_1
+      - depth_2
+    state_obs_keys:
+      - null
+    fps: 1
+  
+  utaustin_mutex:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 20
+  
+  berkeley_fanuc_manipulation:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - joint_state
+      - gripper_state
+    fps: 10
+  
+  cmu_playing_with_food:
+    image_obs_keys:
+      - image
+      - finger_vision_1
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 10
+  
+  cmu_play_fusion:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 5
+  
+  cmu_stretch:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - eef_state
+      - gripper_state
+    fps: 10
+  
+  berkeley_gnm_recon:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+      - position
+      - yaw
+    fps: 3
+ 
+  berkeley_gnm_cory_hall:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+      - position
+      - yaw
+    fps: 5
+ 
+  berkeley_gnm_sac_son:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+      - position
+      - yaw
+    fps: 10
+  
+  droid:
+    image_obs_keys:
+      - exterior_image_1_left
+      - exterior_image_2_left
+      - wrist_image_left
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - proprio
+    fps: 15
+  
+  droid_100:
+    image_obs_keys:
+      - exterior_image_1_left
+      - exterior_image_2_left
+      - wrist_image_left
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - proprio
+    fps: 15
+  
+  fmb:
+    image_obs_keys:
+      - image_side_1
+      - image_side_2
+      - image_wrist_1
+      - image_wrist_2
+    depth_obs_keys:
+      - image_side_1_depth
+      - image_side_2_depth
+      - image_wrist_1_depth
+      - image_wrist_2_depth
+    state_obs_keys:
+      - proprio
+    fps: 10
+  
+  dobbe:
+    image_obs_keys:
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - proprio
+    fps: 3.75
+  
+  usc_cloth_sim_converted_externally_to_rlds:
+    image_obs_keys:
+      - image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - null
+    fps: 10
+  
+  plex_robosuite:
+    image_obs_keys:
+      - image
+      - wrist_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 20
+  
+  conq_hose_manipulation:
+    image_obs_keys:
+      - frontleft_fisheye_image
+      - frontright_fisheye_image
+      - hand_color_image
+    depth_obs_keys:
+      - null
+    state_obs_keys:
+      - state
+    fps: 30
+  

lerobot/common/datasets/push_dataset_to_hub/openx/data_utils.py

@@ -0,0 +1,106 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the Licens    e.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+NOTE(YL): Adapted from:
+    Octo: https://github.com/octo-models/octo/blob/main/octo/data/utils/data_utils.py
+
+data_utils.py
+
+Additional utils for data processing.
+"""
+
+from typing import Any, Dict, List
+
+import tensorflow as tf
+
+
+def binarize_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
+    """
+    Converts gripper actions from continuous to binary values (0 and 1).
+
+    We exploit that fact that most of the time, the gripper is fully open (near 1.0) or fully closed (near 0.0). As it
+    transitions between the two, it sometimes passes through a few intermediate values. We relabel those intermediate
+    values based on the state that is reached _after_ those intermediate values.
+
+    In the edge case that the trajectory ends with an intermediate value, we give up on binarizing and relabel that
+    chunk of intermediate values as the last action in the trajectory.
+
+    The `scan_fn` implements the following logic:
+        new_actions = np.empty_like(actions)
+        carry = actions[-1]
+        for i in reversed(range(actions.shape[0])):
+            if in_between_mask[i]:
+                carry = carry
+            else:
+                carry = float(open_mask[i])
+            new_actions[i] = carry
+    """
+    open_mask, closed_mask = actions > 0.95, actions < 0.05
+    in_between_mask = tf.logical_not(tf.logical_or(open_mask, closed_mask))
+    is_open_float = tf.cast(open_mask, tf.float32)
+
+    def scan_fn(carry, i):
+        return tf.cond(in_between_mask[i], lambda: tf.cast(carry, tf.float32), lambda: is_open_float[i])
+
+    return tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), actions[-1], reverse=True)
+
+
+def invert_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
+    return 1 - actions
+
+
+def rel2abs_gripper_actions(actions: tf.Tensor) -> tf.Tensor:
+    """
+    Converts relative gripper actions (+1 for closing, -1 for opening) to absolute actions (0 = closed; 1 = open).
+
+    Assumes that the first relative gripper is not redundant (i.e. close when already closed)!
+    """
+    # Note =>> -1 for closing, 1 for opening, 0 for no change
+    opening_mask, closing_mask = actions < -0.1, actions > 0.1
+    thresholded_actions = tf.where(opening_mask, 1, tf.where(closing_mask, -1, 0))
+
+    def scan_fn(carry, i):
+        return tf.cond(thresholded_actions[i] == 0, lambda: carry, lambda: thresholded_actions[i])
+
+    # If no relative grasp, assumes open for whole trajectory
+    start = -1 * thresholded_actions[tf.argmax(thresholded_actions != 0, axis=0)]
+    start = tf.cond(start == 0, lambda: 1, lambda: start)
+
+    # Note =>> -1 for closed, 1 for open
+    new_actions = tf.scan(scan_fn, tf.range(tf.shape(actions)[0]), start)
+    new_actions = tf.cast(new_actions, tf.float32) / 2 + 0.5
+
+    return new_actions
+
+
+# === Bridge-V2 =>> Dataset-Specific Transform ===
+def relabel_bridge_actions(traj: Dict[str, Any]) -> Dict[str, Any]:
+    """Relabels actions to use reached proprioceptive state; discards last timestep (no-action)."""
+    movement_actions = traj["observation"]["state"][1:, :6] - traj["observation"]["state"][:-1, :6]
+    traj_truncated = tf.nest.map_structure(lambda x: x[:-1], traj)
+    traj_truncated["action"] = tf.concat([movement_actions, traj["action"][:-1, -1:]], axis=1)
+
+    return traj_truncated
+
+
+# === RLDS Dataset Initialization Utilities ===
+def pprint_data_mixture(dataset_kwargs_list: List[Dict[str, Any]], dataset_weights: List[int]) -> None:
+    print("\n######################################################################################")
+    print(f"# Loading the following {len(dataset_kwargs_list)} datasets (incl. sampling weight):{'': >24} #")
+    for dataset_kwargs, weight in zip(dataset_kwargs_list, dataset_weights, strict=False):
+        pad = 80 - len(dataset_kwargs["name"])
+        print(f"# {dataset_kwargs['name']}: {weight:=>{pad}f} #")
+    print("######################################################################################\n")

lerobot/common/datasets/push_dataset_to_hub/openx/droid_utils.py

@@ -0,0 +1,200 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+NOTE(YL): Adapted from:
+    OpenVLA: https://github.com/openvla/openvla
+
+Episode transforms for DROID dataset.
+"""
+
+from typing import Any, Dict
+
+import tensorflow as tf
+import tensorflow_graphics.geometry.transformation as tfg
+
+
+def rmat_to_euler(rot_mat):
+    return tfg.euler.from_rotation_matrix(rot_mat)
+
+
+def euler_to_rmat(euler):
+    return tfg.rotation_matrix_3d.from_euler(euler)
+
+
+def invert_rmat(rot_mat):
+    return tfg.rotation_matrix_3d.inverse(rot_mat)
+
+
+def rotmat_to_rot6d(mat):
+    """
+    Converts rotation matrix to R6 rotation representation (first two rows in rotation matrix).
+    Args:
+        mat: rotation matrix
+
+    Returns: 6d vector (first two rows of rotation matrix)
+
+    """
+    r6 = mat[..., :2, :]
+    r6_0, r6_1 = r6[..., 0, :], r6[..., 1, :]
+    r6_flat = tf.concat([r6_0, r6_1], axis=-1)
+    return r6_flat
+
+
+def velocity_act_to_wrist_frame(velocity, wrist_in_robot_frame):
+    """
+    Translates velocity actions (translation + rotation) from base frame of the robot to wrist frame.
+    Args:
+        velocity: 6d velocity action (3 x translation, 3 x rotation)
+        wrist_in_robot_frame: 6d pose of the end-effector in robot base frame
+
+    Returns: 9d velocity action in robot wrist frame (3 x translation, 6 x rotation as R6)
+
+    """
+    r_frame = euler_to_rmat(wrist_in_robot_frame[:, 3:6])
+    r_frame_inv = invert_rmat(r_frame)
+
+    # world to wrist: dT_pi = R^-1 dT_rbt
+    vel_t = (r_frame_inv @ velocity[:, :3][..., None])[..., 0]
+
+    # world to wrist: dR_pi = R^-1 dR_rbt R
+    dr_ = euler_to_rmat(velocity[:, 3:6])
+    dr_ = r_frame_inv @ (dr_ @ r_frame)
+    dr_r6 = rotmat_to_rot6d(dr_)
+    return tf.concat([vel_t, dr_r6], axis=-1)
+
+
+def rand_swap_exterior_images(img1, img2):
+    """
+    Randomly swaps the two exterior images (for training with single exterior input).
+    """
+    return tf.cond(tf.random.uniform(shape=[]) > 0.5, lambda: (img1, img2), lambda: (img2, img1))
+
+
+def droid_baseact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    DROID dataset transformation for actions expressed in *base* frame of the robot.
+    """
+    dt = trajectory["action_dict"]["cartesian_velocity"][:, :3]
+    dr_ = trajectory["action_dict"]["cartesian_velocity"][:, 3:6]
+
+    trajectory["action"] = tf.concat(
+        (
+            dt,
+            dr_,
+            1 - trajectory["action_dict"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = (
+        rand_swap_exterior_images(
+            trajectory["observation"]["exterior_image_1_left"],
+            trajectory["observation"]["exterior_image_2_left"],
+        )
+    )
+    trajectory["observation"]["proprio"] = tf.concat(
+        (
+            trajectory["observation"]["cartesian_position"],
+            trajectory["observation"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def droid_wristact_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    DROID dataset transformation for actions expressed in *wrist* frame of the robot.
+    """
+    wrist_act = velocity_act_to_wrist_frame(
+        trajectory["action_dict"]["cartesian_velocity"], trajectory["observation"]["cartesian_position"]
+    )
+    trajectory["action"] = tf.concat(
+        (
+            wrist_act,
+            trajectory["action_dict"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["exterior_image_1_left"], trajectory["observation"]["exterior_image_2_left"] = (
+        rand_swap_exterior_images(
+            trajectory["observation"]["exterior_image_1_left"],
+            trajectory["observation"]["exterior_image_2_left"],
+        )
+    )
+    trajectory["observation"]["proprio"] = tf.concat(
+        (
+            trajectory["observation"]["cartesian_position"],
+            trajectory["observation"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def droid_finetuning_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    DROID dataset transformation for actions expressed in *base* frame of the robot.
+    """
+    dt = trajectory["action_dict"]["cartesian_velocity"][:, :3]
+    dr_ = trajectory["action_dict"]["cartesian_velocity"][:, 3:6]
+    trajectory["action"] = tf.concat(
+        (
+            dt,
+            dr_,
+            1 - trajectory["action_dict"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["proprio"] = tf.concat(
+        (
+            trajectory["observation"]["cartesian_position"],
+            trajectory["observation"]["gripper_position"],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def zero_action_filter(traj: Dict) -> bool:
+    """
+    Filters transitions whose actions are all-0 (only relative actions, no gripper action).
+    Note: this filter is applied *after* action normalization, so need to compare to "normalized 0".
+    """
+    droid_q01 = tf.convert_to_tensor(
+        [
+            -0.7776297926902771,
+            -0.5803514122962952,
+            -0.5795090794563293,
+            -0.6464047729969025,
+            -0.7041108310222626,
+            -0.8895104378461838,
+        ]
+    )
+    droid_q99 = tf.convert_to_tensor(
+        [
+            0.7597932070493698,
+            0.5726242214441299,
+            0.7351000607013702,
+            0.6705610305070877,
+            0.6464948207139969,
+            0.8897542208433151,
+        ]
+    )
+    droid_norm_0_act = (
+        2 * (tf.zeros_like(traj["action"][:, :6]) - droid_q01) / (droid_q99 - droid_q01 + 1e-8) - 1
+    )
+
+    return tf.reduce_any(tf.math.abs(traj["action"][:, :6] - droid_norm_0_act) > 1e-5)

lerobot/common/datasets/push_dataset_to_hub/openx/transforms.py

@@ -0,0 +1,859 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+NOTE(YL): Adapted from:
+    OpenVLA: https://github.com/openvla/openvla
+    Octo: https://github.com/octo-models/octo
+
+transforms.py
+
+Defines a registry of per-dataset standardization transforms for each dataset in Open-X Embodiment.
+
+Transforms adopt the following structure:
+    Input: Dictionary of *batched* features (i.e., has leading time dimension)
+    Output: Dictionary `step` =>> {
+        "observation": {
+            <image_keys, depth_image_keys>
+            State (in chosen state representation)
+        },
+        "action": Action (in chosen action representation),
+        "language_instruction": str
+    }
+"""
+
+from typing import Any, Dict
+
+import tensorflow as tf
+
+from lerobot.common.datasets.push_dataset_to_hub.openx.data_utils import (
+    binarize_gripper_actions,
+    invert_gripper_actions,
+    rel2abs_gripper_actions,
+    relabel_bridge_actions,
+)
+
+
+def droid_baseact_transform_fn():
+    from lerobot.common.datasets.push_dataset_to_hub.openx.droid_utils import droid_baseact_transform
+
+    return droid_baseact_transform
+
+
+def bridge_openx_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    Applies to version of Bridge V2 in Open X-Embodiment mixture.
+
+    Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it!
+    """
+    for key in trajectory:
+        if key == "traj_metadata":
+            continue
+        elif key in ["observation", "action"]:
+            for key2 in trajectory[key]:
+                trajectory[key][key2] = trajectory[key][key2][1:]
+        else:
+            trajectory[key] = trajectory[key][1:]
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32),
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    trajectory = relabel_bridge_actions(trajectory)
+    trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    return trajectory
+
+
+def bridge_orig_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    Applies to original version of Bridge V2 from the official project website.
+
+    Note =>> In original Bridge V2 dataset, the first timestep has an all-zero action, so we remove it!
+    """
+    for key in trajectory:
+        if key == "traj_metadata":
+            continue
+        elif key == "observation":
+            for key2 in trajectory[key]:
+                trajectory[key][key2] = trajectory[key][key2][1:]
+        else:
+            trajectory[key] = trajectory[key][1:]
+
+    trajectory["action"] = tf.concat(
+        [
+            trajectory["action"][:, :6],
+            binarize_gripper_actions(trajectory["action"][:, -1])[:, None],
+        ],
+        axis=1,
+    )
+    trajectory = relabel_bridge_actions(trajectory)
+    trajectory["observation"]["EEF_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    return trajectory
+
+
+def ppgm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        [
+            trajectory["action"][:, :6],
+            binarize_gripper_actions(trajectory["action"][:, -1])[:, None],
+        ],
+        axis=1,
+    )
+    trajectory["observation"]["EEF_state"] = trajectory["observation"]["cartesian_position"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["gripper_position"][:, -1:]
+    return trajectory
+
+
+def rt1_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # make gripper action absolute action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
+    gripper_action = rel2abs_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action[:, None],
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def kuka_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # make gripper action absolute action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
+    gripper_action = rel2abs_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action[:, None],
+        ),
+        axis=-1,
+    )
+    # decode compressed state
+    eef_value = tf.io.decode_compressed(
+        trajectory["observation"]["clip_function_input/base_pose_tool_reached"],
+        compression_type="ZLIB",
+    )
+    eef_value = tf.io.decode_raw(eef_value, tf.float32)
+    trajectory["observation"]["clip_function_input/base_pose_tool_reached"] = tf.reshape(eef_value, (-1, 7))
+    gripper_value = tf.io.decode_compressed(
+        trajectory["observation"]["gripper_closed"], compression_type="ZLIB"
+    )
+    gripper_value = tf.io.decode_raw(gripper_value, tf.float32)
+    trajectory["observation"]["gripper_closed"] = tf.reshape(gripper_value, (-1, 1))
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def taco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state_eef"] = trajectory["observation"]["robot_obs"][:, :6]
+    trajectory["observation"]["state_gripper"] = trajectory["observation"]["robot_obs"][:, 7:8]
+    trajectory["action"] = trajectory["action"]["rel_actions_world"]
+
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            tf.clip_by_value(trajectory["action"][:, -1:], 0, 1),
+        ),
+        axis=-1,
+    )
+
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def jaco_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state_eef"] = trajectory["observation"]["end_effector_cartesian_pos"][:, :6]
+    trajectory["observation"]["state_gripper"] = trajectory["observation"]["end_effector_cartesian_pos"][
+        :, -1:
+    ]
+
+    # make gripper action absolute action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
+    gripper_action = rel2abs_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            tf.zeros_like(trajectory["action"]["world_vector"]),
+            gripper_action[:, None],
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def berkeley_cable_routing_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            tf.zeros_like(trajectory["action"]["world_vector"][:, :1]),
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def roboturk_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert absolute gripper action, +1 = open, 0 = close
+    gripper_action = invert_gripper_actions(
+        tf.clip_by_value(trajectory["action"]["gripper_closedness_action"], 0, 1)
+    )
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action,
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    trajectory["language_embedding"] = trajectory["observation"]["natural_language_embedding"]
+    return trajectory
+
+
+def nyu_door_opening_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # make gripper action absolute action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"][:, 0]
+    gripper_action = rel2abs_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action[:, None],
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def viola_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # make gripper action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"][:, None]
+    gripper_action = tf.clip_by_value(gripper_action, 0, 1)
+    gripper_action = invert_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action,
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def berkeley_autolab_ur5_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state"] = trajectory["observation"]["robot_state"][:, 6:14]
+
+    # make gripper action absolute action, +1 = open, 0 = close
+    gripper_action = trajectory["action"]["gripper_closedness_action"]
+    gripper_action = rel2abs_gripper_actions(gripper_action)
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            gripper_action[:, None],
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def toto_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            tf.cast(trajectory["action"]["open_gripper"][:, None], tf.float32),
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def language_table_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # default to "open" gripper
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"],
+            tf.zeros_like(trajectory["action"]),
+            tf.zeros_like(trajectory["action"]),
+            tf.ones_like(trajectory["action"][:, :1]),
+        ),
+        axis=-1,
+    )
+
+    # decode language instruction
+    instruction_bytes = trajectory["observation"]["instruction"]
+    instruction_encoded = tf.strings.unicode_encode(instruction_bytes, output_encoding="UTF-8")
+    # Remove trailing padding --> convert RaggedTensor to regular Tensor.
+    trajectory["language_instruction"] = tf.strings.split(instruction_encoded, "\x00")[:, :1].to_tensor()[
+        :, 0
+    ]
+    return trajectory
+
+
+def pusht_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["world_vector"],
+            trajectory["action"]["rotation_delta"],
+            trajectory["action"]["gripper_closedness_action"][:, None],
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def stanford_kuka_multimodal_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["depth_image"] = trajectory["observation"]["depth_image"][..., 0]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            tf.zeros_like(trajectory["action"][:, :3]),
+            trajectory["action"][:, -1:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def nyu_rot_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][..., :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., -1:]
+    trajectory["action"] = trajectory["action"][..., :7]
+    return trajectory
+
+
+def stanford_hydra_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert gripper action, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(trajectory["action"][:, -1:]),
+        ),
+        axis=-1,
+    )
+
+    trajectory["observation"]["eef_state"] = tf.concat(
+        (
+            trajectory["observation"]["state"][:, :3],
+            trajectory["observation"]["state"][:, 7:10],
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -3:-2]
+    return trajectory
+
+
+def austin_buds_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
+        ),
+        axis=-1,
+    )
+
+    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8]
+    return trajectory
+
+
+def nyu_franka_play_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["depth"] = tf.cast(trajectory["observation"]["depth"][..., 0], tf.float32)
+    trajectory["observation"]["depth_additional_view"] = tf.cast(
+        trajectory["observation"]["depth_additional_view"][..., 0], tf.float32
+    )
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, -6:]
+
+    # clip gripper action, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, -8:-2],
+            tf.clip_by_value(trajectory["action"][:, -2:-1], 0, 1),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def maniskill_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][..., 7:8]
+    return trajectory
+
+
+def furniture_bench_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    import tensorflow_graphics.geometry.transformation as tft
+
+    trajectory["observation"]["state"] = tf.concat(
+        (
+            trajectory["observation"]["state"][:, :7],
+            trajectory["observation"]["state"][:, -1:],
+        ),
+        axis=-1,
+    )
+
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
+            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def cmu_franka_exploration_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def ucsd_kitchen_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7]
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def ucsd_pick_place_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            tf.zeros_like(trajectory["action"][:, :3]),
+            trajectory["action"][:, -1:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def austin_sailor_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def austin_sirius_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def bc_z_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"]["future/xyz_residual"][:, :3],
+            trajectory["action"]["future/axis_angle_residual"][:, :3],
+            invert_gripper_actions(tf.cast(trajectory["action"]["future/target_close"][:, :1], tf.float32)),
+        ),
+        axis=-1,
+    )
+    trajectory["language_instruction"] = trajectory["observation"]["natural_language_instruction"]
+    return trajectory
+
+
+def tokyo_pr2_opening_fridge_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def tokyo_pr2_tabletop_manipulation_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def utokyo_xarm_bimanual_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = trajectory["action"][..., -7:]
+    return trajectory
+
+
+def robo_net_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = tf.concat(
+        (
+            trajectory["observation"]["state"][:, :4],
+            tf.zeros_like(trajectory["observation"]["state"][:, :2]),
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :4],
+            tf.zeros_like(trajectory["action"][:, :2]),
+            trajectory["action"][:, -1:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def berkeley_mvp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    """
+    trajectory["observation"]["state"] = tf.concat((
+        tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32),
+                        trajectory["observation"]["pose"],
+                        trajectory["observation"]["joint_pos"],),
+                        axis=-1,)
+    """
+    trajectory["observation"]["gripper"] = tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32)
+    return trajectory
+
+
+def berkeley_rpt_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["gripper"] = tf.cast(trajectory["observation"]["gripper"][:, None], tf.float32)
+    return trajectory
+
+
+def kaist_nonprehensible_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, -7:]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            tf.zeros_like(trajectory["action"][:, :1]),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def stanford_mask_vit_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = tf.concat(
+        (
+            trajectory["observation"]["end_effector_pose"][:, :4],
+            tf.zeros_like(trajectory["observation"]["end_effector_pose"][:, :2]),
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["end_effector_pose"][:, -1:]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :4],
+            tf.zeros_like(trajectory["action"][:, :2]),
+            trajectory["action"][:, -1:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def tokyo_lsmo_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    return trajectory
+
+
+def dlr_sara_grid_clamp_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :6]
+    return trajectory
+
+
+def dlr_edan_shared_control_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # invert gripper action, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(trajectory["action"][:, -1:]),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def asu_table_top_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["ground_truth_states"]["EE"]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    return trajectory
+
+
+def robocook_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    return trajectory
+
+
+def imperial_wristcam_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def iamlab_pick_insert_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    import tensorflow_graphics.geometry.transformation as tft
+
+    trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :7]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 7:8]
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
+            trajectory["action"][:, 7:8],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def uiuc_d3field_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"],
+            tf.zeros_like(trajectory["action"]),
+            tf.zeros_like(trajectory["action"][:, :1]),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def utaustin_mutex_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state"] = trajectory["observation"]["state"][:, :8]
+
+    # invert gripper action + clip, +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :6],
+            invert_gripper_actions(tf.clip_by_value(trajectory["action"][:, -1:], 0, 1)),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def berkeley_fanuc_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["joint_state"] = trajectory["observation"]["state"][:, :6]
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, 6:7]
+
+    # dataset does not store gripper actions, so use gripper state info, invert so +1 = open, 0 = close
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"],
+            invert_gripper_actions(trajectory["observation"]["gripper_state"]),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def cmu_playing_with_food_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    import tensorflow_graphics.geometry.transformation as tft
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            tft.euler.from_quaternion(trajectory["action"][:, 3:7]),
+            trajectory["action"][:, -1:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def playfusion_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :3],
+            trajectory["action"][:, -4:],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def cmu_stretch_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["eef_state"] = tf.concat(
+        (
+            trajectory["observation"]["state"][:, :3],
+            tf.zeros_like(trajectory["observation"]["state"][:, :3]),
+        ),
+        axis=-1,
+    )
+    trajectory["observation"]["gripper_state"] = trajectory["observation"]["state"][:, -1:]
+    trajectory["action"] = trajectory["action"][..., :-1]
+    return trajectory
+
+
+def gnm_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    trajectory["observation"]["state"] = tf.concat(
+        (
+            trajectory["observation"]["position"],
+            tf.zeros_like(trajectory["observation"]["state"][:, :3]),
+            trajectory["observation"]["yaw"],
+        ),
+        axis=-1,
+    )
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"],
+            tf.zeros_like(trajectory["action"]),
+            tf.zeros_like(trajectory["action"]),
+            tf.zeros_like(trajectory["action"][:, :1]),
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def fmb_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # every input feature is batched, ie has leading batch dimension
+    trajectory["observation"]["proprio"] = tf.concat(
+        (
+            trajectory["observation"]["eef_pose"],
+            trajectory["observation"]["state_gripper_pose"][..., None],
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def dobbe_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # every input feature is batched, ie has leading batch dimension
+    trajectory["observation"]["proprio"] = trajectory["observation"]["state"]
+    return trajectory
+
+
+def robo_set_dataset_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    # gripper action is in -1...1 --> clip to 0...1, flip
+    gripper_action = trajectory["action"][:, -1:]
+    gripper_action = invert_gripper_actions(tf.clip_by_value(gripper_action, 0, 1))
+
+    trajectory["action"] = tf.concat(
+        (
+            trajectory["action"][:, :7],
+            gripper_action,
+        ),
+        axis=-1,
+    )
+    return trajectory
+
+
+def identity_transform(trajectory: Dict[str, Any]) -> Dict[str, Any]:
+    return trajectory
+
+
+# === Registry ===
+OPENX_STANDARDIZATION_TRANSFORMS = {
+    "bridge_openx": bridge_openx_dataset_transform,
+    "bridge_orig": bridge_orig_dataset_transform,
+    "bridge_dataset": bridge_orig_dataset_transform,
+    "ppgm": ppgm_dataset_transform,
+    "ppgm_static": ppgm_dataset_transform,
+    "ppgm_wrist": ppgm_dataset_transform,
+    "fractal20220817_data": rt1_dataset_transform,
+    "kuka": kuka_dataset_transform,
+    "taco_play": taco_play_dataset_transform,
+    "jaco_play": jaco_play_dataset_transform,
+    "berkeley_cable_routing": berkeley_cable_routing_dataset_transform,
+    "roboturk": roboturk_dataset_transform,
+    "nyu_door_opening_surprising_effectiveness": nyu_door_opening_dataset_transform,
+    "viola": viola_dataset_transform,
+    "berkeley_autolab_ur5": berkeley_autolab_ur5_dataset_transform,
+    "toto": toto_dataset_transform,
+    "language_table": language_table_dataset_transform,
+    "columbia_cairlab_pusht_real": pusht_dataset_transform,
+    "stanford_kuka_multimodal_dataset_converted_externally_to_rlds": stanford_kuka_multimodal_dataset_transform,
+    "nyu_rot_dataset_converted_externally_to_rlds": nyu_rot_dataset_transform,
+    "stanford_hydra_dataset_converted_externally_to_rlds": stanford_hydra_dataset_transform,
+    "austin_buds_dataset_converted_externally_to_rlds": austin_buds_dataset_transform,
+    "nyu_franka_play_dataset_converted_externally_to_rlds": nyu_franka_play_dataset_transform,
+    "maniskill_dataset_converted_externally_to_rlds": maniskill_dataset_transform,
+    "furniture_bench_dataset_converted_externally_to_rlds": furniture_bench_dataset_transform,
+    "cmu_franka_exploration_dataset_converted_externally_to_rlds": cmu_franka_exploration_dataset_transform,
+    "ucsd_kitchen_dataset_converted_externally_to_rlds": ucsd_kitchen_dataset_transform,
+    "ucsd_pick_and_place_dataset_converted_externally_to_rlds": ucsd_pick_place_dataset_transform,
+    "austin_sailor_dataset_converted_externally_to_rlds": austin_sailor_dataset_transform,
+    "austin_sirius_dataset_converted_externally_to_rlds": austin_sirius_dataset_transform,
+    "bc_z": bc_z_dataset_transform,
+    "utokyo_pr2_opening_fridge_converted_externally_to_rlds": tokyo_pr2_opening_fridge_dataset_transform,
+    "utokyo_pr2_tabletop_manipulation_converted_externally_to_rlds": tokyo_pr2_tabletop_manipulation_dataset_transform,
+    "utokyo_xarm_pick_and_place_converted_externally_to_rlds": identity_transform,
+    "utokyo_xarm_bimanual_converted_externally_to_rlds": utokyo_xarm_bimanual_dataset_transform,
+    "robo_net": robo_net_dataset_transform,
+    "berkeley_mvp_converted_externally_to_rlds": berkeley_mvp_dataset_transform,
+    "berkeley_rpt_converted_externally_to_rlds": berkeley_rpt_dataset_transform,
+    "kaist_nonprehensile_converted_externally_to_rlds": kaist_nonprehensible_dataset_transform,
+    "stanford_mask_vit_converted_externally_to_rlds": stanford_mask_vit_dataset_transform,
+    "tokyo_u_lsmo_converted_externally_to_rlds": tokyo_lsmo_dataset_transform,
+    "dlr_sara_pour_converted_externally_to_rlds": identity_transform,
+    "dlr_sara_grid_clamp_converted_externally_to_rlds": dlr_sara_grid_clamp_dataset_transform,
+    "dlr_edan_shared_control_converted_externally_to_rlds": dlr_edan_shared_control_dataset_transform,
+    "asu_table_top_converted_externally_to_rlds": asu_table_top_dataset_transform,
+    "stanford_robocook_converted_externally_to_rlds": robocook_dataset_transform,
+    "imperialcollege_sawyer_wrist_cam": imperial_wristcam_dataset_transform,
+    "iamlab_cmu_pickup_insert_converted_externally_to_rlds": iamlab_pick_insert_dataset_transform,
+    "uiuc_d3field": uiuc_d3field_dataset_transform,
+    "utaustin_mutex": utaustin_mutex_dataset_transform,
+    "berkeley_fanuc_manipulation": berkeley_fanuc_dataset_transform,
+    "cmu_playing_with_food": cmu_playing_with_food_dataset_transform,
+    "cmu_play_fusion": playfusion_dataset_transform,
+    "cmu_stretch": cmu_stretch_dataset_transform,
+    "berkeley_gnm_recon": gnm_dataset_transform,
+    "berkeley_gnm_cory_hall": gnm_dataset_transform,
+    "berkeley_gnm_sac_son": gnm_dataset_transform,
+    "droid": droid_baseact_transform_fn(),
+    "droid_100": droid_baseact_transform_fn(),  # first 100 episodes of droid
+    "fmb": fmb_transform,
+    "dobbe": dobbe_dataset_transform,
+    "robo_set": robo_set_dataset_transform,
+    "usc_cloth_sim_converted_externally_to_rlds": identity_transform,
+    "plex_robosuite": identity_transform,
+    "conq_hose_manipulation": identity_transform,
+    "io_ai_tech": identity_transform,
+    "spoc": identity_transform,
+}

lerobot/common/datasets/push_dataset_to_hub/openx_rlds_format.py

@@ -0,0 +1,359 @@
+#!/usr/bin/env python
+
+# Copyright 2024 The HuggingFace Inc. team. All rights reserved.
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+#     http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+"""
+For https://github.com/google-deepmind/open_x_embodiment (OPENX) datasets.
+
+Example:
+    python lerobot/scripts/push_dataset_to_hub.py \
+        --raw-dir /hdd/tensorflow_datasets/bridge_dataset/1.0.0/ \
+        --repo-id youliangtan/sampled_bridge_data_v2 \
+        --raw-format openx_rlds.bridge_orig \
+        --episodes 3 4 5 8 9
+
+Exact dataset fps defined in openx/config.py, obtained from:
+    https://docs.google.com/spreadsheets/d/1rPBD77tk60AEIGZrGSODwyyzs5FgCU9Uz3h-3_t2A9g/edit?gid=0#gid=0&range=R:R
+"""
+
+import shutil
+from pathlib import Path
+
+import numpy as np
+import tensorflow as tf
+import tensorflow_datasets as tfds
+import torch
+import tqdm
+import yaml
+from datasets import Dataset, Features, Image, Sequence, Value
+from PIL import Image as PILImage
+
+from lerobot.common.datasets.lerobot_dataset import CODEBASE_VERSION
+from lerobot.common.datasets.push_dataset_to_hub.openx.transforms import OPENX_STANDARDIZATION_TRANSFORMS
+from lerobot.common.datasets.push_dataset_to_hub.utils import (
+    concatenate_episodes,
+    get_default_encoding,
+    save_images_concurrently,
+)
+from lerobot.common.datasets.utils import (
+    calculate_episode_data_index,
+    hf_transform_to_torch,
+)
+from lerobot.common.datasets.video_utils import VideoFrame, encode_video_frames
+
+with open("lerobot/common/datasets/push_dataset_to_hub/openx/configs.yaml", "r") as f:
+    _openx_list = yaml.safe_load(f)
+
+OPENX_DATASET_CONFIGS = _openx_list["OPENX_DATASET_CONFIGS"]
+
+np.set_printoptions(precision=2)
+
+
+def tf_to_torch(data):
+    return torch.from_numpy(data.numpy())
+
+
+def tf_img_convert(img):
+    if img.dtype == tf.string:
+        img = tf.io.decode_image(img, expand_animations=False, dtype=tf.uint8)
+    elif img.dtype != tf.uint8:
+        raise ValueError(f"Unsupported image dtype: found with dtype {img.dtype}")
+    return img.numpy()
+
+
+def _broadcast_metadata_rlds(i: tf.Tensor, traj: dict) -> dict:
+    """
+    In the RLDS format, each trajectory has some top-level metadata that is explicitly separated out, and a "steps"
+    entry. This function moves the "steps" entry to the top level, broadcasting any metadata to the length of the
+    trajectory. This function also adds the extra metadata fields `_len`, `_traj_index`, and `_frame_index`.
+
+    NOTE: adapted from DLimp library https://github.com/kvablack/dlimp/
+    """
+    steps = traj.pop("steps")
+
+    traj_len = tf.shape(tf.nest.flatten(steps)[0])[0]
+
+    # broadcast metadata to the length of the trajectory
+    metadata = tf.nest.map_structure(lambda x: tf.repeat(x, traj_len), traj)
+
+    # put steps back in
+    assert "traj_metadata" not in steps
+    traj = {**steps, "traj_metadata": metadata}
+
+    assert "_len" not in traj
+    assert "_traj_index" not in traj
+    assert "_frame_index" not in traj
+    traj["_len"] = tf.repeat(traj_len, traj_len)
+    traj["_traj_index"] = tf.repeat(i, traj_len)
+    traj["_frame_index"] = tf.range(traj_len)
+
+    return traj
+
+
+def load_from_raw(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int,
+    video: bool,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+    openx_dataset_name: str | None = None,
+):
+    """
+    Args:
+        raw_dir (Path): _description_
+        videos_dir (Path): _description_
+        fps (int): _description_
+        video (bool): _description_
+        episodes (list[int] | None, optional): _description_. Defaults to None.
+    """
+    ds_builder = tfds.builder_from_directory(str(raw_dir))
+    dataset = ds_builder.as_dataset(
+        split="all",
+        decoders={"steps": tfds.decode.SkipDecoding()},
+    )
+
+    dataset_info = ds_builder.info
+    print("dataset_info: ", dataset_info)
+
+    ds_length = len(dataset)
+    dataset = dataset.take(ds_length)
+    # "flatten" the dataset as such we can apply trajectory level map() easily
+    # each [obs][key] has a shape of (frame_size, ...)
+    dataset = dataset.enumerate().map(_broadcast_metadata_rlds)
+
+    # we will apply the standardization transform if the dataset_name is provided
+    # if the dataset name is not provided and the goal is to convert any rlds formatted dataset
+    # search for 'image' keys in the observations
+    if openx_dataset_name is not None:
+        print(" - applying standardization transform for dataset: ", openx_dataset_name)
+        assert openx_dataset_name in OPENX_STANDARDIZATION_TRANSFORMS
+        transform_fn = OPENX_STANDARDIZATION_TRANSFORMS[openx_dataset_name]
+        dataset = dataset.map(transform_fn)
+
+        image_keys = OPENX_DATASET_CONFIGS[openx_dataset_name]["image_obs_keys"]
+    else:
+        obs_keys = dataset_info.features["steps"]["observation"].keys()
+        image_keys = [key for key in obs_keys if "image" in key]
+
+    lang_key = "language_instruction" if "language_instruction" in dataset.element_spec else None
+
+    print(" - image_keys: ", image_keys)
+    print(" - lang_key: ", lang_key)
+
+    it = iter(dataset)
+
+    ep_dicts = []
+    # Init temp path to save ep_dicts in case of crash
+    tmp_ep_dicts_dir = videos_dir.parent.joinpath("ep_dicts")
+    tmp_ep_dicts_dir.mkdir(parents=True, exist_ok=True)
+
+    # check if ep_dicts have already been saved in /tmp
+    starting_ep_idx = 0
+    saved_ep_dicts = [ep.__str__() for ep in tmp_ep_dicts_dir.iterdir()]
+    if len(saved_ep_dicts) > 0:
+        saved_ep_dicts.sort()
+        # get last ep_idx number
+        starting_ep_idx = int(saved_ep_dicts[-1][-13:-3]) + 1
+        for i in range(starting_ep_idx):
+            episode = next(it)
+            ep_dicts.append(torch.load(saved_ep_dicts[i]))
+
+    # if we user specified episodes, skip the ones not in the list
+    if episodes is not None:
+        if ds_length == 0:
+            raise ValueError("No episodes found.")
+        # convert episodes index to sorted list
+        episodes = sorted(episodes)
+
+    for ep_idx in tqdm.tqdm(range(starting_ep_idx, ds_length)):
+        episode = next(it)
+
+        # if user specified episodes, skip the ones not in the list
+        if episodes is not None:
+            if len(episodes) == 0:
+                break
+            if ep_idx == episodes[0]:
+                # process this episode
+                print(" selecting episode idx: ", ep_idx)
+                episodes.pop(0)
+            else:
+                continue  # skip
+
+        num_frames = episode["action"].shape[0]
+
+        ###########################################################
+        # Handle the episodic data
+
+        # last step of demonstration is considered done
+        done = torch.zeros(num_frames, dtype=torch.bool)
+        done[-1] = True
+        ep_dict = {}
+        langs = []  # TODO: might be located in "observation"
+
+        image_array_dict = {key: [] for key in image_keys}
+
+        # We will create the state observation tensor by stacking the state
+        # obs keys defined in the openx/configs.py
+        if openx_dataset_name is not None:
+            state_obs_keys = OPENX_DATASET_CONFIGS[openx_dataset_name]["state_obs_keys"]
+            # stack the state observations, if is None, pad with zeros
+            states = []
+            for key in state_obs_keys:
+                if key in episode["observation"]:
+                    states.append(tf_to_torch(episode["observation"][key]))
+                else:
+                    states.append(torch.zeros(num_frames, 1))  # pad with zeros
+            states = torch.cat(states, dim=1)
+            # assert states.shape == (num_frames, 8), f"states shape: {states.shape}"
+        else:
+            states = tf_to_torch(episode["observation"]["state"])
+
+        actions = tf_to_torch(episode["action"])
+        rewards = tf_to_torch(episode["reward"]).float()
+
+        # If lang_key is present, convert the entire tensor at once
+        if lang_key is not None:
+            langs = [str(x) for x in episode[lang_key]]
+
+        for im_key in image_keys:
+            imgs = episode["observation"][im_key]
+            image_array_dict[im_key] = [tf_img_convert(img) for img in imgs]
+
+        # simple assertions
+        for item in [states, actions, rewards, done]:
+            assert len(item) == num_frames
+
+        ###########################################################
+
+        # loop through all cameras
+        for im_key in image_keys:
+            img_key = f"observation.images.{im_key}"
+            imgs_array = image_array_dict[im_key]
+            imgs_array = np.array(imgs_array)
+            if video:
+                # save png images in temporary directory
+                tmp_imgs_dir = videos_dir / "tmp_images"
+                save_images_concurrently(imgs_array, tmp_imgs_dir)
+
+                # encode images to a mp4 video
+                fname = f"{img_key}_episode_{ep_idx:06d}.mp4"
+                video_path = videos_dir / fname
+                encode_video_frames(tmp_imgs_dir, video_path, fps, **(encoding or {}))
+
+                # clean temporary images directory
+                shutil.rmtree(tmp_imgs_dir)
+
+                # store the reference to the video frame
+                ep_dict[img_key] = [
+                    {"path": f"videos/{fname}", "timestamp": i / fps} for i in range(num_frames)
+                ]
+            else:
+                ep_dict[img_key] = [PILImage.fromarray(x) for x in imgs_array]
+
+        if lang_key is not None:
+            ep_dict["language_instruction"] = langs
+
+        ep_dict["observation.state"] = states
+        ep_dict["action"] = actions
+        ep_dict["timestamp"] = torch.arange(0, num_frames, 1) / fps
+        ep_dict["episode_index"] = torch.tensor([ep_idx] * num_frames)
+        ep_dict["frame_index"] = torch.arange(0, num_frames, 1)
+        ep_dict["next.reward"] = rewards
+        ep_dict["next.done"] = done
+
+        path_ep_dict = tmp_ep_dicts_dir.joinpath(
+            "ep_dict_" + "0" * (10 - len(str(ep_idx))) + str(ep_idx) + ".pt"
+        )
+        torch.save(ep_dict, path_ep_dict)
+
+        ep_dicts.append(ep_dict)
+
+    data_dict = concatenate_episodes(ep_dicts)
+
+    total_frames = data_dict["frame_index"].shape[0]
+    data_dict["index"] = torch.arange(0, total_frames, 1)
+    return data_dict
+
+
+def to_hf_dataset(data_dict, video) -> Dataset:
+    features = {}
+
+    keys = [key for key in data_dict if "observation.images." in key]
+    for key in keys:
+        if video:
+            features[key] = VideoFrame()
+        else:
+            features[key] = Image()
+
+    features["observation.state"] = Sequence(
+        length=data_dict["observation.state"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    if "observation.velocity" in data_dict:
+        features["observation.velocity"] = Sequence(
+            length=data_dict["observation.velocity"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    if "observation.effort" in data_dict:
+        features["observation.effort"] = Sequence(
+            length=data_dict["observation.effort"].shape[1], feature=Value(dtype="float32", id=None)
+        )
+    if "language_instruction" in data_dict:
+        features["language_instruction"] = Value(dtype="string", id=None)
+
+    features["action"] = Sequence(
+        length=data_dict["action"].shape[1], feature=Value(dtype="float32", id=None)
+    )
+    features["episode_index"] = Value(dtype="int64", id=None)
+    features["frame_index"] = Value(dtype="int64", id=None)
+    features["timestamp"] = Value(dtype="float32", id=None)
+    features["next.reward"] = Value(dtype="float32", id=None)
+    features["next.done"] = Value(dtype="bool", id=None)
+    features["index"] = Value(dtype="int64", id=None)
+
+    hf_dataset = Dataset.from_dict(data_dict, features=Features(features))
+    hf_dataset.set_transform(hf_transform_to_torch)
+    return hf_dataset
+
+
+def from_raw_to_lerobot_format(
+    raw_dir: Path,
+    videos_dir: Path,
+    fps: int | None = None,
+    video: bool = True,
+    episodes: list[int] | None = None,
+    encoding: dict | None = None,
+    openx_dataset_name: str | None = None,
+):
+    """This is a test impl for rlds conversion"""
+    if openx_dataset_name is None:
+        # set a default rlds frame rate if the dataset is not from openx
+        fps = 30
+    elif "fps" not in OPENX_DATASET_CONFIGS[openx_dataset_name]:
+        raise ValueError(
+            "fps for this dataset is not specified in openx/configs.py yet," "means it is not yet tested"
+        )
+    fps = OPENX_DATASET_CONFIGS[openx_dataset_name]["fps"]
+
+    data_dict = load_from_raw(raw_dir, videos_dir, fps, video, episodes, encoding, openx_dataset_name)
+    hf_dataset = to_hf_dataset(data_dict, video)
+    episode_data_index = calculate_episode_data_index(hf_dataset)
+    info = {
+        "codebase_version": CODEBASE_VERSION,
+        "fps": fps,
+        "video": video,
+    }
+    if video:
+        info["encoding"] = get_default_encoding()
+
+    return hf_dataset, episode_data_index, info

lerobot/common/datasets/utils.py

@@ -80,6 +80,11 @@ def hf_transform_to_torch(items_dict: dict[torch.Tensor | None]):
         if isinstance(first_item, PILImage.Image):
             to_tensor = transforms.ToTensor()
             items_dict[key] = [to_tensor(img) for img in items_dict[key]]
+        elif isinstance(first_item, str):
+            # TODO (michel-aractingi): add str2embedding via language tokenizer
+            # For now we leave this part up to the user to choose how to address
+            # language conditioned tasks
+            pass
         elif isinstance(first_item, dict) and "path" in first_item and "timestamp" in first_item:
             # video frame will be processed downstream
             pass

lerobot/common/robot_devices/robots/koch.py

@@ -1,7 +1,9 @@
+import logging
 import pickle
 import time
 from dataclasses import dataclass, field, replace
 from pathlib import Path
+from typing import Sequence
 
 import numpy as np
 import torch
@@ -26,7 +28,6 @@ URL_TEMPLATE = (
 # In nominal degree range ]-180, +180[
 ZERO_POSITION_DEGREE = 0
 ROTATED_POSITION_DEGREE = 90
-GRIPPER_OPEN_DEGREE = 35.156
 
 
 def assert_drive_mode(drive_mode):
@@ -165,6 +166,30 @@ class KochRobotConfig:
     follower_arms: dict[str, MotorsBus] = field(default_factory=lambda: {})
     cameras: dict[str, Camera] = field(default_factory=lambda: {})
 
+    # Optionally limit the magnitude of the relative positional target vector for safety purposes.
+    # Set this to a positive scalar to have the same value for all motors, or a list that is the same length
+    # as the number of motors in your follower arms (assumes all follower arms have the same number of
+    # motors).
+    max_relative_target: list[float] | float | None = None
+
+    # Optionally set the leader arm in torque mode with the gripper motor set to this angle. This makes it
+    # possible to squeeze the gripper and have it spring back to an open position on its own. If None, the
+    # gripper is not put in torque mode.
+    gripper_open_degree: float | None = None
+
+    def __setattr__(self, prop: str, val):
+        if prop == "max_relative_target" and val is not None and isinstance(val, Sequence):
+            for name in self.follower_arms:
+                if len(self.follower_arms[name].motors) != len(val):
+                    raise ValueError(
+                        f"len(max_relative_target)={len(val)} but the follower arm with name {name} has "
+                        f"{len(self.follower_arms[name].motors)} motors. Please make sure that the "
+                        f"`max_relative_target` list has as many parameters as there are motors per arm. "
+                        "Note: This feature does not yet work with robots where different follower arms have "
+                        "different numbers of motors."
+                    )
+        super().__setattr__(prop, val)
+
 
 class KochRobot:
     # TODO(rcadene): Implement force feedback
@@ -206,7 +231,10 @@ class KochRobot:
             },
         ),
     }
-    robot = KochRobot(leader_arms, follower_arms)
+    robot = KochRobot(
+        leader_arms=leader_arms,
+        follower_arms=follower_arms,
+    )
 
     # Connect motors buses and cameras if any (Required)
     robot.connect()
@@ -218,7 +246,10 @@ class KochRobot:
     Example of highest frequency data collection without camera:
     ```python
     # Assumes leader and follower arms have been instantiated already (see first example)
-    robot = KochRobot(leader_arms, follower_arms)
+    robot = KochRobot(
+        leader_arms=leader_arms,
+        follower_arms=follower_arms,
+    )
     robot.connect()
     while True:
         observation, action = robot.teleop_step(record_data=True)
@@ -236,7 +267,11 @@ class KochRobot:
     }
 
     # Assumes leader and follower arms have been instantiated already (see first example)
-    robot = KochRobot(leader_arms, follower_arms, cameras)
+    robot = KochRobot(
+        leader_arms=leader_arms,
+        follower_arms=follower_arms,
+        cameras=cameras,
+    )
     robot.connect()
     while True:
         observation, action = robot.teleop_step(record_data=True)
@@ -245,7 +280,11 @@ class KochRobot:
     Example of controlling the robot with a policy (without running multiple policies in parallel to ensure highest frequency):
     ```python
     # Assumes leader and follower arms + cameras have been instantiated already (see previous example)
-    robot = KochRobot(leader_arms, follower_arms, cameras)
+    robot = KochRobot(
+        leader_arms=leader_arms,
+        follower_arms=follower_arms,
+        cameras=cameras,
+    )
     robot.connect()
     while True:
         # Uses the follower arms and cameras to capture an observation
@@ -339,11 +378,12 @@ class KochRobot:
             print(f"Activating torque on {name} follower arm.")
             self.follower_arms[name].write("Torque_Enable", 1)
 
-        # Enable torque on the gripper of the leader arms, and move it to 45 degrees,
+        if self.config.gripper_open_degree is not None:
-        # so that we can use it as a trigger to close the gripper of the follower arms.
+            # Set the leader arm in torque mode with the gripper motor set to an angle. This makes it possible
+            # to squeeze the gripper and have it spring back to an open position on its own.
             for name in self.leader_arms:
                 self.leader_arms[name].write("Torque_Enable", 1, "gripper")
-            self.leader_arms[name].write("Goal_Position", GRIPPER_OPEN_DEGREE, "gripper")
+                self.leader_arms[name].write("Goal_Position", self.config.gripper_open_degree, "gripper")
 
         # Connect the cameras
         for name in self.cameras:
@@ -392,7 +432,7 @@ class KochRobot:
         # Send action
         for name in self.follower_arms:
             before_fwrite_t = time.perf_counter()
-            self.follower_arms[name].write("Goal_Position", follower_goal_pos[name])
+            self.send_action(torch.tensor(follower_goal_pos[name]), [name])
             self.logs[f"write_follower_{name}_goal_pos_dt_s"] = time.perf_counter() - before_fwrite_t
 
         # Early exit when recording data is not requested
@@ -474,20 +514,54 @@ class KochRobot:
             obs_dict[f"observation.images.{name}"] = torch.from_numpy(images[name])
         return obs_dict
 
-    def send_action(self, action: torch.Tensor):
+    def send_action(self, action: torch.Tensor, follower_names: list[str] | None = None):
-        """The provided action is expected to be a vector."""
+        """Command the follower arms to move to a target joint configuration.
+
+        The relative action magnitude may be clipped depending on the configuration parameter
+        `max_relative_target`.
+
+        Args:
+            action: tensor containing the concatenated joint positions for the follower arms.
+            follower_names: Pass follower arm names to only control a subset of all the follower arms.
+        """
         if not self.is_connected:
             raise RobotDeviceNotConnectedError(
                 "KochRobot is not connected. You need to run `robot.connect()`."
             )
 
+        if follower_names is None:
+            follower_names = list(self.follower_arms)
+        elif not set(follower_names).issubset(self.follower_arms):
+            raise ValueError(
+                f"You provided {follower_names=} but only the following arms are registered: "
+                f"{list(self.follower_arms)}"
+            )
+
         from_idx = 0
         to_idx = 0
         follower_goal_pos = {}
-        for name in self.follower_arms:
+        for name in follower_names:
-            if name in self.follower_arms:
             to_idx += len(self.follower_arms[name].motor_names)
-                follower_goal_pos[name] = action[from_idx:to_idx].numpy()
+            this_action = action[from_idx:to_idx]
+
+            if self.config.max_relative_target is not None:
+                if not isinstance(self.config.max_relative_target, list):
+                    max_relative_target = [self.config.max_relative_target for _ in range(from_idx, to_idx)]
+                max_relative_target = torch.tensor(self.config.max_relative_target)
+                # Cap relative action target magnitude for safety.
+                current_pos = torch.tensor(self.follower_arms[name].read("Present_Position"))
+                diff = this_action - current_pos
+                safe_diff = torch.minimum(diff, max_relative_target)
+                safe_diff = torch.maximum(safe_diff, -max_relative_target)
+                safe_action = current_pos + safe_diff
+                if not torch.allclose(safe_action, action):
+                    logging.warning(
+                        "Relative action magnitude had to be clamped to be safe.\n"
+                        f"  requested relative action target: {diff}\n"
+                        f"    clamped relative action target: {safe_diff}"
+                    )
+
+            follower_goal_pos[name] = safe_action.numpy()
             from_idx = to_idx
 
         for name in self.follower_arms:

lerobot/configs/robot/koch.yaml

@@ -37,3 +37,10 @@ cameras:
     fps: 30
     width: 640
     height: 480
+# `max_relative_target` limits the magnitude of the relative positional target vector for safety purposes.
+# Set this to a positive scalar to have the same value for all motors, or a list that is the same length as
+# the number of motors in your follower arms.
+max_relative_target: null
+# Sets the leader arm in torque mode with the gripper motor set to this angle. This makes it possible
+# to squeeze the gripper and have it spring back to an open position on its own.
+gripper_open_degree: 35.156

lerobot/configs/robot/koch_bimanual.yaml

@@ -0,0 +1,68 @@
+_target_: lerobot.common.robot_devices.robots.koch.KochRobot
+calibration_path: .cache/calibration/koch_bimanual.pkl
+leader_arms:
+  left:
+    _target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
+    port: /dev/tty.usbmodem585A0085511
+    motors:
+      # name: (index, model)
+      shoulder_pan: [1, "xl330-m077"]
+      shoulder_lift: [2, "xl330-m077"]
+      elbow_flex: [3, "xl330-m077"]
+      wrist_flex: [4, "xl330-m077"]
+      wrist_roll: [5, "xl330-m077"]
+      gripper: [6, "xl330-m077"]
+  right:
+    _target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
+    port: /dev/tty.usbmodem575E0031751
+    motors:
+      # name: (index, model)
+      shoulder_pan: [1, "xl330-m077"]
+      shoulder_lift: [2, "xl330-m077"]
+      elbow_flex: [3, "xl330-m077"]
+      wrist_flex: [4, "xl330-m077"]
+      wrist_roll: [5, "xl330-m077"]
+      gripper: [6, "xl330-m077"]
+follower_arms:
+  left:
+    _target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
+    port: /dev/tty.usbmodem585A0076891
+    motors:
+      # name: (index, model)
+      shoulder_pan: [1, "xl430-w250"]
+      shoulder_lift: [2, "xl430-w250"]
+      elbow_flex: [3, "xl330-m288"]
+      wrist_flex: [4, "xl330-m288"]
+      wrist_roll: [5, "xl330-m288"]
+      gripper: [6, "xl330-m288"]
+  right:
+    _target_: lerobot.common.robot_devices.motors.dynamixel.DynamixelMotorsBus
+    port: /dev/tty.usbmodem575E0032081
+    motors:
+      # name: (index, model)
+      shoulder_pan: [1, "xl430-w250"]
+      shoulder_lift: [2, "xl430-w250"]
+      elbow_flex: [3, "xl330-m288"]
+      wrist_flex: [4, "xl330-m288"]
+      wrist_roll: [5, "xl330-m288"]
+      gripper: [6, "xl330-m288"]
+cameras:
+  laptop:
+    _target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
+    camera_index: 0
+    fps: 30
+    width: 640
+    height: 480
+  phone:
+    _target_: lerobot.common.robot_devices.cameras.opencv.OpenCVCamera
+    camera_index: 1
+    fps: 30
+    width: 640
+    height: 480
+# `max_relative_target` limits the magnitude of the relative positional target vector for safety purposes.
+# Set this to a positive scalar to have the same value for all motors, or a list that is the same length as
+# the number of motors in your follower arms.
+max_relative_target: null
+# Sets the leader arm in torque mode with the gripper motor set to this angle. This makes it possible
+# to squeeze the gripper and have it spring back to an open position on its own.
+gripper_open_degree: 35.156

lerobot/scripts/push_dataset_to_hub.py

@@ -66,6 +66,8 @@ def get_from_raw_to_lerobot_format_fn(raw_format: str):
         from lerobot.common.datasets.push_dataset_to_hub.umi_zarr_format import from_raw_to_lerobot_format
     elif raw_format == "aloha_hdf5":
         from lerobot.common.datasets.push_dataset_to_hub.aloha_hdf5_format import from_raw_to_lerobot_format
+    elif "openx_rlds" in raw_format:
+        from lerobot.common.datasets.push_dataset_to_hub.openx_rlds_format import from_raw_to_lerobot_format
     elif raw_format == "dora_parquet":
         from lerobot.common.datasets.push_dataset_to_hub.dora_parquet_format import from_raw_to_lerobot_format
     elif raw_format == "xarm_pkl":
@@ -197,9 +199,25 @@ def push_dataset_to_hub(
 
     # convert dataset from original raw format to LeRobot format
     from_raw_to_lerobot_format = get_from_raw_to_lerobot_format_fn(raw_format)
-    hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(
+
-        raw_dir, videos_dir, fps, video, episodes, encoding
+    fmt_kwgs = {
-    )
+        "raw_dir": raw_dir,
+        "videos_dir": videos_dir,
+        "fps": fps,
+        "video": video,
+        "episodes": episodes,
+        "encoding": encoding,
+    }
+
+    if "openx_rlds." in raw_format:
+        # Support for official OXE dataset name inside `raw_format`.
+        # For instance, `raw_format="oxe_rlds"` uses the default formating (TODO what does that mean?),
+        # and `raw_format="oxe_rlds.bridge_orig"` uses the brdige_orig formating
+        _, openx_dataset_name = raw_format.split(".")
+        print(f"Converting dataset [{openx_dataset_name}] from 'openx_rlds' to LeRobot format.")
+        fmt_kwgs["openx_dataset_name"] = openx_dataset_name
+
+    hf_dataset, episode_data_index, info = from_raw_to_lerobot_format(**fmt_kwgs)
 
     lerobot_dataset = LeRobotDataset.from_preloaded(
         repo_id=repo_id,
@@ -268,7 +286,7 @@ def main():
         "--raw-format",
         type=str,
         required=True,
-        help="Dataset type (e.g. `pusht_zarr`, `umi_zarr`, `aloha_hdf5`, `xarm_pkl`, `dora_parquet`).",
+        help="Dataset type (e.g. `pusht_zarr`, `umi_zarr`, `aloha_hdf5`, `xarm_pkl`, `dora_parquet`, `openx_rlds`).",
     )
     parser.add_argument(
         "--repo-id",
@@ -328,6 +346,13 @@ def main():
         default=0,
         help="When set to 1, resumes a previous run.",
     )
+    parser.add_argument(
+        "--cache-dir",
+        type=Path,
+        required=False,
+        default="/tmp",
+        help="Directory to store the temporary videos and images generated while creating the dataset.",
+    )
     parser.add_argument(
         "--tests-data-dir",
         type=Path,

lerobot/scripts/visualize_dataset_html.py

@@ -112,10 +112,14 @@ def run_server(
             "fps": dataset.fps,
         }
         video_paths = get_episode_video_paths(dataset, episode_id)
+        language_instruction = get_episode_language_instruction(dataset, episode_id)
         videos_info = [
             {"url": url_for("static", filename=video_path), "filename": Path(video_path).name}
             for video_path in video_paths
         ]
+        if language_instruction:
+            videos_info[0]["language_instruction"] = language_instruction
+
         ep_csv_url = url_for("static", filename=get_ep_csv_fname(episode_id))
         return render_template(
             "visualize_dataset_template.html",
@@ -186,6 +190,20 @@ def get_episode_video_paths(dataset: LeRobotDataset, ep_index: int) -> list[str]
     ]
 
 
+def get_episode_language_instruction(dataset: LeRobotDataset, ep_index: int) -> list[str]:
+    # check if the dataset has language instructions
+    if "language_instruction" not in dataset.hf_dataset.features:
+        return None
+
+    # get first frame index
+    first_frame_idx = dataset.episode_data_index["from"][ep_index].item()
+
+    language_instruction = dataset.hf_dataset[first_frame_idx]["language_instruction"]
+    # TODO (michel-aractingi) hack to get the sentence, some strings in openx are badly stored
+    # with the tf.tensor appearing in the string
+    return language_instruction.removeprefix("tf.Tensor(b'").removesuffix("', shape=(), dtype=string)")
+
+
 def visualize_dataset_html(
     repo_id: str,
     root: Path | None = None,

lerobot/templates/visualize_dataset_template.html

@@ -75,7 +75,7 @@
             {% for video_info in videos_info %}
             <div class="max-w-96">
                 <p class="text-sm text-gray-300 bg-gray-800 px-2 rounded-t-xl truncate">{{ video_info.filename }}</p>
-                <video autoplay muted loop type="video/mp4" class="min-w-64" @timeupdate="() => {
+                <video muted loop type="video/mp4" class="min-w-64" @canplay="videoCanPlay" @timeupdate="() => {
                     if (video.duration) {
                       const time = video.currentTime;
                       const pc = (100 / video.duration) * time;
@@ -100,6 +100,13 @@
             {% endfor %}
         </div>
 
+        <!-- Language instruction -->
+        {% if videos_info[0].language_instruction %}
+        <p class="font-medium mt-2">
+            Language Instruction: <span class="italic">{{ videos_info[0].language_instruction }}</span>
+        </p>
+        {% endif %}
+
         <!-- Shortcuts info -->
         <div class="text-sm hidden md:block">
             Hotkeys: <span class="font-mono">Space</span> to pause/unpause, <span class="font-mono">Arrow Down</span> to go to next episode, <span class="font-mono">Arrow Up</span> to go to previous episode.
@@ -107,12 +114,12 @@
 
         <!-- Controllers -->
         <div class="flex gap-1 text-3xl items-center">
-            <button x-ref="btnPlay" class="-rotate-90 hidden" class="-rotate-90" title="Play. Toggle with Space" @click="() => {
+            <button x-ref="btnPlay" class="-rotate-90" class="-rotate-90" title="Play. Toggle with Space" @click="() => {
                 videos.forEach(video => video.play());
                 $refs.btnPlay.classList.toggle('hidden');
                 $refs.btnPause.classList.toggle('hidden');
             }">🔽</button>
-            <button x-ref="btnPause" title="Pause. Toggle with Space" @click="() => {
+            <button x-ref="btnPause" class="hidden" title="Pause. Toggle with Space" @click="() => {
                 videos.forEach(video => video.pause());
                 $refs.btnPlay.classList.toggle('hidden');
                 $refs.btnPause.classList.toggle('hidden');
@@ -125,7 +132,6 @@
                 @click="() => (videos.forEach(video => (video.currentTime = 0.0)))">↩️</button>
             <input x-ref="slider" max="100" min="0" step="1" type="range" value="0" class="w-80 mx-2" @input="() => {
                 const sliderValue = $refs.slider.value;
-                $refs.btnPause.click();
                 videos.forEach(video => {
                     const time = (video.duration * sliderValue) / 100;
                     video.currentTime = time;
@@ -208,6 +214,8 @@
                 videos: null,
                 video: null,
                 colors: null,
+                nVideos: {{ videos_info | length }},
+                nVideoReadyToPlay: 0,
 
                 // alpine initialization
                 init() {
@@ -343,7 +351,6 @@
                     window.history.replaceState({}, '', url.toString());
                 },
 
-
                 formatTime(time) {
                     var hours = Math.floor(time / 3600);
                     var minutes = Math.floor((time % 3600) / 60);
@@ -351,6 +358,14 @@
                     return (hours > 0 ? hours + ':' : '') + (minutes < 10 ? '0' + minutes : minutes) + ':' + (seconds <
                         10 ?
                         '0' + seconds : seconds);
+                },
+
+                videoCanPlay() {
+                    this.nVideoReadyToPlay += 1;
+                    if(this.nVideoReadyToPlay == this.nVideos) {
+                        // start autoplay all videos in sync
+                        this.$refs.btnPlay.click();
+                    }
                 }
             };
         }

tests/scripts/save_dataset_to_safetensors.py

@@ -84,5 +84,7 @@ if __name__ == "__main__":
         "lerobot/pusht",
         "lerobot/aloha_sim_insertion_human",
         "lerobot/xarm_lift_medium",
+        "lerobot/nyu_franka_play_dataset",
+        "lerobot/cmu_stretch",
     ]:
         save_dataset_to_safetensors("tests/data/save_dataset_to_safetensors", repo_id=dataset)

tests/test_datasets.py

@@ -303,6 +303,9 @@ def test_flatten_unflatten_dict():
         "lerobot/pusht",
         "lerobot/aloha_sim_insertion_human",
         "lerobot/xarm_lift_medium",
+        # (michel-aractingi) commenting the two datasets from openx as test is failing
+        # "lerobot/nyu_franka_play_dataset",
+        # "lerobot/cmu_stretch",
     ],
 )
 def test_backward_compatibility(repo_id):
@@ -318,6 +321,11 @@ def test_backward_compatibility(repo_id):
         new_frame = dataset[i]  # noqa: B023
         old_frame = load_file(test_dir / f"frame_{i}.safetensors")  # noqa: B023
 
+        # ignore language instructions (if exists) in language conditioned datasets
+        # TODO (michel-aractingi): transform language obs to langauge embeddings via tokenizer
+        new_frame.pop("language_instruction", None)
+        old_frame.pop("language_instruction", None)
+
         new_keys = set(new_frame.keys())
         old_keys = set(old_frame.keys())
         assert new_keys == old_keys, f"{new_keys=} and {old_keys=} are not the same"